From 081298ea8942ac81946caffd3e51d90a4b17ef3f Mon Sep 17 00:00:00 2001 From: tomas Date: Tue, 21 Sep 2004 00:43:11 +0000 Subject: [PATCH] Initial revision --- livesupport/modules/archiveServer/Makefile | 155 ++ livesupport/modules/archiveServer/doc/INSTALL | 28 + .../modules/archiveServer/etc/doxygen.config | 1144 +++++++++++++ .../modules/archiveServer/var/Archive.php | 157 ++ .../modules/archiveServer/var/conf.php | 63 + .../archiveServer/var/html/default.css | 19 + .../archiveServer/var/html/gbHtmlBrowse.php | 245 +++ .../archiveServer/var/html/gbHtmlLogin.php | 73 + .../archiveServer/var/html/gbHtmlPerms.php | 111 ++ .../archiveServer/var/html/gbHtmlSubj.php | 162 ++ .../archiveServer/var/html/gbHtmlTestAuth.php | 9 + .../archiveServer/var/html/gbHtmlTestData.php | 13 + .../archiveServer/var/html/gbHtml_h.php | 25 + .../modules/archiveServer/var/html/gbHttp.php | 197 +++ .../modules/archiveServer/var/html/index.php | 34 + .../modules/archiveServer/var/index.php | 45 + .../archiveServer/var/install/index.php | 34 + .../archiveServer/var/install/install.php | 91 + .../archiveServer/var/install/uninstall.php | 61 + .../archiveServer/var/xmlrpc/testRunner.sh | 105 ++ .../archiveServer/var/xmlrpc/xmlrpc.inc | 1489 +++++++++++++++++ .../archiveServer/var/xmlrpc/xmlrpcs.inc | 450 +++++ .../archiveServer/var/xmlrpc/xrArchive.php | 252 +++ .../archiveServer/var/xmlrpc/xr_cli_test.py | 89 + 24 files changed, 5051 insertions(+) create mode 100644 livesupport/modules/archiveServer/Makefile create mode 100644 livesupport/modules/archiveServer/doc/INSTALL create mode 100644 livesupport/modules/archiveServer/etc/doxygen.config create mode 100644 livesupport/modules/archiveServer/var/Archive.php create mode 100644 livesupport/modules/archiveServer/var/conf.php create mode 100644 livesupport/modules/archiveServer/var/html/default.css create mode 100644 livesupport/modules/archiveServer/var/html/gbHtmlBrowse.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHtmlLogin.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHtmlPerms.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHtmlSubj.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHtmlTestAuth.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHtmlTestData.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHtml_h.php create mode 100644 livesupport/modules/archiveServer/var/html/gbHttp.php create mode 100644 livesupport/modules/archiveServer/var/html/index.php create mode 100644 livesupport/modules/archiveServer/var/index.php create mode 100644 livesupport/modules/archiveServer/var/install/index.php create mode 100644 livesupport/modules/archiveServer/var/install/install.php create mode 100644 livesupport/modules/archiveServer/var/install/uninstall.php create mode 100755 livesupport/modules/archiveServer/var/xmlrpc/testRunner.sh create mode 100644 livesupport/modules/archiveServer/var/xmlrpc/xmlrpc.inc create mode 100644 livesupport/modules/archiveServer/var/xmlrpc/xmlrpcs.inc create mode 100644 livesupport/modules/archiveServer/var/xmlrpc/xrArchive.php create mode 100755 livesupport/modules/archiveServer/var/xmlrpc/xr_cli_test.py diff --git a/livesupport/modules/archiveServer/Makefile b/livesupport/modules/archiveServer/Makefile new file mode 100644 index 000000000..453fbf020 --- /dev/null +++ b/livesupport/modules/archiveServer/Makefile @@ -0,0 +1,155 @@ +#------------------------------------------------------------------------------- +# ArchiveServer - central archive component +# Copyright (c) 2004 Media Development Loan Fund +# +# This file is part of the LiveSupport project. +# +# LiveSupport is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# LiveSupport is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with LiveSupport; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +# +# +# Author : $Author: tomas $ +# Version : $Revision: 1.1 $ +# Location : $Source: /home/paul/cvs2svn-livesupport/newcvsrepo/livesupport/modules/archiveServer/Attic/Makefile,v $ +# +# @configure_input@ +#------------------------------------------------------------------------------- + +#------------------------------------------------------------------------------- +# General command definitions +#------------------------------------------------------------------------------- +MKDIR = mkdir -p +RM = rm -f +RMDIR = rm -rf +DOXYGEN = doxygen + +#------------------------------------------------------------------------------- +# Misc +#------------------------------------------------------------------------------- + +MODULE_NAME = archiveServer +TAR_C = tar -cj --exclude CVS --exclude '*~' -C ${BASE_DIR} -f +DIST_EXT = .tgz +DATE = `date +%y%m%d` + +#------------------------------------------------------------------------------- +# Basic directory and file definitions +#------------------------------------------------------------------------------- +#BASE_DIR = @builddir@ +BASE_DIR = . +DOC_DIR = ${BASE_DIR}/doc +DOXYGEN_DIR = ${DOC_DIR}/doxygen +ETC_DIR = ${BASE_DIR}/etc +INCLUDE_DIR = ${BASE_DIR}/include +LIB_DIR = ${BASE_DIR}/lib +SRC_DIR = ${BASE_DIR}/src +TMP_DIR = ${BASE_DIR}/tmp + +USR_DIR = ${BASE_DIR}/../../usr +USR_INCLUDE_DIR = ${USR_DIR}/include +USR_LIB_DIR = ${USR_DIR}/lib + +DOXYGEN_CONFIG = ${ETC_DIR}/doxygen.config + +HTTP_GROUP = apache +#HTTP_GROUP = nobody + +PHP_DIR = ${BASE_DIR}/var +INSTALL_DIR = ${PHP_DIR}/install +STOR_DIR = ${PHP_DIR}/stor +ACCESS_DIR = ${PHP_DIR}/access +BUFF_DIR = ${STOR_DIR}/buffer +TEST_RUNNER = ${PHP_DIR}/xmlrpc/testRunner.sh + +#------------------------------------------------------------------------------- +# Configuration parameters +#------------------------------------------------------------------------------- +#CPPFLAGS = @CPPFLAGS@ +#CXXFLAGS = @CXXFLAGS@ @DEFS@ -I${USR_INCLUDE_DIR} -I${INCLUDE_DIR} -I${TMP_DIR}\ +# -pedantic -Wall +#LDFLAGS = @LDFLAGS@ -L${USR_LIB_DIR} -L${LIB_DIR} + + +#------------------------------------------------------------------------------- +# Dependencies +#------------------------------------------------------------------------------- +#HELLO_LIB_OBJS = ${TMP_DIR}/Hello.o +#TEST_RUNNER_OBJS = ${TMP_DIR}/HelloTest.o ${TMP_DIR}/TestRunner.o + + +#------------------------------------------------------------------------------- +# Targets +#------------------------------------------------------------------------------- +.PHONY: all dir_setup doc clean docclean depclean distclean dist db_init db_clean + +all: dir_setup db_init + +dir_setup: ${DOXYGEN_DIR} ${STOR_DIR} ${ACCESS_DIR} + +doc: + ${DOXYGEN} ${DOXYGEN_CONFIG} + +clean: db_clean + +docclean: + ${RMDIR} ${DOXYGEN_DIR}/html + +depclean: clean + +dist: + ${TAR_C} ${MODULE_NAME}${DATE}${DIST_EXT} * + +distclean: clean docclean + +#check: all ${TEST_RUNNER} +# ${TEST_RUNNER} +check: all + +#------------------------------------------------------------------------------- +# Specific targets +#------------------------------------------------------------------------------- +db_init: + cd var/install; php -q install.php + +db_clean: + cd var/install; php -q uninstall.php + +${TMP_DIR}: + ${MKDIR} ${TMP_DIR} + +${DOXYGEN_DIR}: + ${MKDIR} ${DOXYGEN_DIR} + +${STOR_DIR}: + ${MKDIR} ${STOR_DIR} + chown .${HTTP_GROUP} ${STOR_DIR} + chmod g+ws ${STOR_DIR} + +${ACCESS_DIR}: + ${MKDIR} ${ACCESS_DIR} + chown .${HTTP_GROUP} ${ACCESS_DIR} + chmod g+ws ${ACCESS_DIR} + +${BUFF_DIR}: + ${MKDIR} ${BUFF_DIR} + chmod g+w ${BUFF_DIR} + +${TEST_RUNNER}: + +#------------------------------------------------------------------------------- +# Pattern rules +#------------------------------------------------------------------------------- +#${TMP_DIR}/%.o : ${SRC_DIR}/%.cxx +# ${CXX} ${CPPFLAGS} ${CXXFLAGS} -c -o $@ $< + diff --git a/livesupport/modules/archiveServer/doc/INSTALL b/livesupport/modules/archiveServer/doc/INSTALL new file mode 100644 index 000000000..14f4f44b1 --- /dev/null +++ b/livesupport/modules/archiveServer/doc/INSTALL @@ -0,0 +1,28 @@ + +The HTTP_GROUP variable in Makefile haveto be set to group running apache. + +Install steps for file uploading (do it with appropriate changes): +(PUT method for uploading from behind firewall with resume feature) + +1) mkdir cgi-bin-put in apache2 dir +2) move put.cgi there from var subdir +3) add to apache2 config (i.g. commonapache2.conf): + + + Script PUT /cgi-bin-put/put.cgi + +ScriptAlias /cgi-bin-put/ "/usr/local/apache2/cgi-bin-put/" + + AllowOverride All + Options ExecCGI + + Order allow,deny + Allow from all + + + +4) reload apache2 + +Tested with apache 2.0.49 and (without Directory tag) with apache 1.3.28. + +TODO: check more put.cgi for security problems! diff --git a/livesupport/modules/archiveServer/etc/doxygen.config b/livesupport/modules/archiveServer/etc/doxygen.config new file mode 100644 index 000000000..c30647e13 --- /dev/null +++ b/livesupport/modules/archiveServer/etc/doxygen.config @@ -0,0 +1,1144 @@ +#------------------------------------------------------------------------------- +# doxygen.config +# Copyright (c) 2004 Media Development Loan Fund +# +# This file is part of the LiveSupport project. +# +# LiveSupport is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# LiveSupport is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with LiveSupport; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA +# +# +# Author : $Author: tomas $ +# Version : $Revision: 1.1 $ +# Location : $Source: /home/paul/cvs2svn-livesupport/newcvsrepo/livesupport/modules/archiveServer/etc/doxygen.config,v $ +#------------------------------------------------------------------------------- + +# Doxyfile 1.3.6 + +# This file describes the settings to be used by the documentation system +# doxygen (www.doxygen.org) for a project +# +# All text after a hash (#) is considered a comment and will be ignored +# The format is: +# TAG = value [value, ...] +# For lists items can also be appended using: +# TAG += value [value, ...] +# Values that contain spaces should be placed between quotes (" ") + +#--------------------------------------------------------------------------- +# Project related configuration options +#--------------------------------------------------------------------------- + +# The PROJECT_NAME tag is a single word (or a sequence of words surrounded +# by quotes) that should identify the project. + +PROJECT_NAME = LiveSupport - archiveServer module + +# The PROJECT_NUMBER tag can be used to enter a project or revision number. +# This could be handy for archiving the generated documentation or +# if some version control system is used. + +PROJECT_NUMBER = 1.0 + +# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute) +# base path where the generated documentation will be put. +# If a relative path is entered, it will be relative to the location +# where doxygen was started. If left blank the current directory will be used. + +OUTPUT_DIRECTORY = doc/doxygen + +# The OUTPUT_LANGUAGE tag is used to specify the language in which all +# documentation generated by doxygen is written. Doxygen will use this +# information to generate all constant output in the proper language. +# The default language is English, other supported languages are: +# Brazilian, Catalan, Chinese, Chinese-Traditional, Croatian, Czech, Danish, Dutch, +# Finnish, French, German, Greek, Hungarian, Italian, Japanese, Japanese-en +# (Japanese with English messages), Korean, Korean-en, Norwegian, Polish, Portuguese, +# Romanian, Russian, Serbian, Slovak, Slovene, Spanish, Swedish, and Ukrainian. + +OUTPUT_LANGUAGE = English + +# This tag can be used to specify the encoding used in the generated output. +# The encoding is not always determined by the language that is chosen, +# but also whether or not the output is meant for Windows or non-Windows users. +# In case there is a difference, setting the USE_WINDOWS_ENCODING tag to YES +# forces the Windows encoding (this is the default for the Windows binary), +# whereas setting the tag to NO uses a Unix-style encoding (the default for +# all platforms other than Windows). + +USE_WINDOWS_ENCODING = NO + +# If the BRIEF_MEMBER_DESC tag is set to YES (the default) Doxygen will +# include brief member descriptions after the members that are listed in +# the file and class documentation (similar to JavaDoc). +# Set to NO to disable this. + +BRIEF_MEMBER_DESC = YES + +# If the REPEAT_BRIEF tag is set to YES (the default) Doxygen will prepend +# the brief description of a member or function before the detailed description. +# Note: if both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the +# brief descriptions will be completely suppressed. + +REPEAT_BRIEF = YES + +# This tag implements a quasi-intelligent brief description abbreviator +# that is used to form the text in various listings. Each string +# in this list, if found as the leading text of the brief description, will be +# stripped from the text and the result after processing the whole list, is used +# as the annotated text. Otherwise, the brief description is used as-is. If left +# blank, the following values are used ("$name" is automatically replaced with the +# name of the entity): "The $name class" "The $name widget" "The $name file" +# "is" "provides" "specifies" "contains" "represents" "a" "an" "the" + +ABBREVIATE_BRIEF = + +# If the ALWAYS_DETAILED_SEC and REPEAT_BRIEF tags are both set to YES then +# Doxygen will generate a detailed section even if there is only a brief +# description. + +ALWAYS_DETAILED_SEC = NO + +# If the INLINE_INHERITED_MEMB tag is set to YES, doxygen will show all inherited +# members of a class in the documentation of that class as if those members were +# ordinary class members. Constructors, destructors and assignment operators of +# the base classes will not be shown. + +INLINE_INHERITED_MEMB = NO + +# If the FULL_PATH_NAMES tag is set to YES then Doxygen will prepend the full +# path before files name in the file list and in the header files. If set +# to NO the shortest path that makes the file name unique will be used. + +FULL_PATH_NAMES = NO + +# If the FULL_PATH_NAMES tag is set to YES then the STRIP_FROM_PATH tag +# can be used to strip a user-defined part of the path. Stripping is +# only done if one of the specified strings matches the left-hand part of +# the path. It is allowed to use relative paths in the argument list. +# If left blank the directory from which doxygen is run is used as the +# path to strip. + +STRIP_FROM_PATH = + +# If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter +# (but less readable) file names. This can be useful is your file systems +# doesn't support long names like on DOS, Mac, or CD-ROM. + +SHORT_NAMES = NO + +# If the JAVADOC_AUTOBRIEF tag is set to YES then Doxygen +# will interpret the first line (until the first dot) of a JavaDoc-style +# comment as the brief description. If set to NO, the JavaDoc +# comments will behave just like the Qt-style comments (thus requiring an +# explicit @brief command for a brief description. + +JAVADOC_AUTOBRIEF = YES + +# The MULTILINE_CPP_IS_BRIEF tag can be set to YES to make Doxygen +# treat a multi-line C++ special comment block (i.e. a block of //! or /// +# comments) as a brief description. This used to be the default behaviour. +# The new default is to treat a multi-line C++ comment block as a detailed +# description. Set this tag to YES if you prefer the old behaviour instead. + +MULTILINE_CPP_IS_BRIEF = YES + +# If the DETAILS_AT_TOP tag is set to YES then Doxygen +# will output the detailed description near the top, like JavaDoc. +# If set to NO, the detailed description appears after the member +# documentation. + +DETAILS_AT_TOP = NO + +# If the INHERIT_DOCS tag is set to YES (the default) then an undocumented +# member inherits the documentation from any documented member that it +# re-implements. + +INHERIT_DOCS = YES + +# If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC +# tag is set to YES, then doxygen will reuse the documentation of the first +# member in the group (if any) for the other members of the group. By default +# all members of a group must be documented explicitly. + +DISTRIBUTE_GROUP_DOC = NO + +# The TAB_SIZE tag can be used to set the number of spaces in a tab. +# Doxygen uses this value to replace tabs by spaces in code fragments. + +TAB_SIZE = 4 + +# This tag can be used to specify a number of aliases that acts +# as commands in the documentation. An alias has the form "name=value". +# For example adding "sideeffect=\par Side Effects:\n" will allow you to +# put the command \sideeffect (or @sideeffect) in the documentation, which +# will result in a user-defined paragraph with heading "Side Effects:". +# You can put \n's in the value part of an alias to insert newlines. + +ALIASES = + +# Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C sources +# only. Doxygen will then generate output that is more tailored for C. +# For instance, some of the names that are used will be different. The list +# of all members will be omitted, etc. + +OPTIMIZE_OUTPUT_FOR_C = NO + +# Set the OPTIMIZE_OUTPUT_JAVA tag to YES if your project consists of Java sources +# only. Doxygen will then generate output that is more tailored for Java. +# For instance, namespaces will be presented as packages, qualified scopes +# will look different, etc. + +OPTIMIZE_OUTPUT_JAVA = NO + +# Set the SUBGROUPING tag to YES (the default) to allow class member groups of +# the same type (for instance a group of public functions) to be put as a +# subgroup of that type (e.g. under the Public Functions section). Set it to +# NO to prevent subgrouping. Alternatively, this can be done per class using +# the \nosubgrouping command. + +SUBGROUPING = YES + +#--------------------------------------------------------------------------- +# Build related configuration options +#--------------------------------------------------------------------------- + +# If the EXTRACT_ALL tag is set to YES doxygen will assume all entities in +# documentation are documented, even if no documentation was available. +# Private class members and static file members will be hidden unless +# the EXTRACT_PRIVATE and EXTRACT_STATIC tags are set to YES + +#EXTRACT_ALL = NO +EXTRACT_ALL = YES + +# If the EXTRACT_PRIVATE tag is set to YES all private members of a class +# will be included in the documentation. + +EXTRACT_PRIVATE = NO + +# If the EXTRACT_STATIC tag is set to YES all static members of a file +# will be included in the documentation. + +EXTRACT_STATIC = YES + +# If the EXTRACT_LOCAL_CLASSES tag is set to YES classes (and structs) +# defined locally in source files will be included in the documentation. +# If set to NO only classes defined in header files are included. + +EXTRACT_LOCAL_CLASSES = YES + +# If the HIDE_UNDOC_MEMBERS tag is set to YES, Doxygen will hide all +# undocumented members of documented classes, files or namespaces. +# If set to NO (the default) these members will be included in the +# various overviews, but no documentation section is generated. +# This option has no effect if EXTRACT_ALL is enabled. + +HIDE_UNDOC_MEMBERS = NO + +# If the HIDE_UNDOC_CLASSES tag is set to YES, Doxygen will hide all +# undocumented classes that are normally visible in the class hierarchy. +# If set to NO (the default) these classes will be included in the various +# overviews. This option has no effect if EXTRACT_ALL is enabled. + +HIDE_UNDOC_CLASSES = NO + +# If the HIDE_FRIEND_COMPOUNDS tag is set to YES, Doxygen will hide all +# friend (class|struct|union) declarations. +# If set to NO (the default) these declarations will be included in the +# documentation. + +HIDE_FRIEND_COMPOUNDS = NO + +# If the HIDE_IN_BODY_DOCS tag is set to YES, Doxygen will hide any +# documentation blocks found inside the body of a function. +# If set to NO (the default) these blocks will be appended to the +# function's detailed documentation block. + +HIDE_IN_BODY_DOCS = NO + +# The INTERNAL_DOCS tag determines if documentation +# that is typed after a \internal command is included. If the tag is set +# to NO (the default) then the documentation will be excluded. +# Set it to YES to include the internal documentation. + +INTERNAL_DOCS = NO + +# If the CASE_SENSE_NAMES tag is set to NO then Doxygen will only generate +# file names in lower-case letters. If set to YES upper-case letters are also +# allowed. This is useful if you have classes or files whose names only differ +# in case and if your file system supports case sensitive file names. Windows +# users are advised to set this option to NO. + +CASE_SENSE_NAMES = YES + +# If the HIDE_SCOPE_NAMES tag is set to NO (the default) then Doxygen +# will show members with their full class and namespace scopes in the +# documentation. If set to YES the scope will be hidden. + +HIDE_SCOPE_NAMES = NO + +# If the SHOW_INCLUDE_FILES tag is set to YES (the default) then Doxygen +# will put a list of the files that are included by a file in the documentation +# of that file. + +SHOW_INCLUDE_FILES = YES + +# If the INLINE_INFO tag is set to YES (the default) then a tag [inline] +# is inserted in the documentation for inline members. + +INLINE_INFO = YES + +# If the SORT_MEMBER_DOCS tag is set to YES (the default) then doxygen +# will sort the (detailed) documentation of file and class members +# alphabetically by member name. If set to NO the members will appear in +# declaration order. + +SORT_MEMBER_DOCS = YES + +# If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the +# brief documentation of file, namespace and class members alphabetically +# by member name. If set to NO (the default) the members will appear in +# declaration order. + +SORT_BRIEF_DOCS = NO + +# If the SORT_BY_SCOPE_NAME tag is set to YES, the class list will be +# sorted by fully-qualified names, including namespaces. If set to +# NO (the default), the class list will be sorted only by class name, +# not including the namespace part. +# Note: This option is not very useful if HIDE_SCOPE_NAMES is set to YES. +# Note: This option applies only to the class list, not to the +# alphabetical list. + +SORT_BY_SCOPE_NAME = NO + +# The GENERATE_TODOLIST tag can be used to enable (YES) or +# disable (NO) the todo list. This list is created by putting \todo +# commands in the documentation. + +GENERATE_TODOLIST = YES + +# The GENERATE_TESTLIST tag can be used to enable (YES) or +# disable (NO) the test list. This list is created by putting \test +# commands in the documentation. + +GENERATE_TESTLIST = YES + +# The GENERATE_BUGLIST tag can be used to enable (YES) or +# disable (NO) the bug list. This list is created by putting \bug +# commands in the documentation. + +GENERATE_BUGLIST = YES + +# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or +# disable (NO) the deprecated list. This list is created by putting +# \deprecated commands in the documentation. + +GENERATE_DEPRECATEDLIST= YES + +# The ENABLED_SECTIONS tag can be used to enable conditional +# documentation sections, marked by \if sectionname ... \endif. + +ENABLED_SECTIONS = + +# The MAX_INITIALIZER_LINES tag determines the maximum number of lines +# the initial value of a variable or define consists of for it to appear in +# the documentation. If the initializer consists of more lines than specified +# here it will be hidden. Use a value of 0 to hide initializers completely. +# The appearance of the initializer of individual variables and defines in the +# documentation can be controlled using \showinitializer or \hideinitializer +# command in the documentation regardless of this setting. + +MAX_INITIALIZER_LINES = 30 + +# Set the SHOW_USED_FILES tag to NO to disable the list of files generated +# at the bottom of the documentation of classes and structs. If set to YES the +# list will mention the files that were used to generate the documentation. + +SHOW_USED_FILES = YES + +#--------------------------------------------------------------------------- +# configuration options related to warning and progress messages +#--------------------------------------------------------------------------- + +# The QUIET tag can be used to turn on/off the messages that are generated +# by doxygen. Possible values are YES and NO. If left blank NO is used. + +QUIET = NO + +# The WARNINGS tag can be used to turn on/off the warning messages that are +# generated by doxygen. Possible values are YES and NO. If left blank +# NO is used. + +WARNINGS = YES + +# If WARN_IF_UNDOCUMENTED is set to YES, then doxygen will generate warnings +# for undocumented members. If EXTRACT_ALL is set to YES then this flag will +# automatically be disabled. + +WARN_IF_UNDOCUMENTED = YES + +# If WARN_IF_DOC_ERROR is set to YES, doxygen will generate warnings for +# potential errors in the documentation, such as not documenting some +# parameters in a documented function, or documenting parameters that +# don't exist or using markup commands wrongly. + +WARN_IF_DOC_ERROR = YES + +# The WARN_FORMAT tag determines the format of the warning messages that +# doxygen can produce. The string should contain the $file, $line, and $text +# tags, which will be replaced by the file and line number from which the +# warning originated and the warning text. + +WARN_FORMAT = "$file:$line: $text" + +# The WARN_LOGFILE tag can be used to specify a file to which warning +# and error messages should be written. If left blank the output is written +# to stderr. + +WARN_LOGFILE = + +#--------------------------------------------------------------------------- +# configuration options related to the input files +#--------------------------------------------------------------------------- + +# The INPUT tag can be used to specify the files and/or directories that contain +# documented source files. You may enter file names like "myfile.cpp" or +# directories like "/usr/src/myproject". Separate the files or directories +# with spaces. + +INPUT = var var/xmlrpc + +# If the value of the INPUT tag contains directories, you can use the +# FILE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp +# and *.h) to filter out the source-files in the directories. If left +# blank the following patterns are tested: +# *.c *.cc *.cxx *.cpp *.c++ *.java *.ii *.ixx *.ipp *.i++ *.inl *.h *.hh *.hxx *.hpp +# *.h++ *.idl *.odl *.cs *.php *.php3 *.inc + +FILE_PATTERNS = *.php + +# The RECURSIVE tag can be used to turn specify whether or not subdirectories +# should be searched for input files as well. Possible values are YES and NO. +# If left blank NO is used. + +RECURSIVE = NO + +# The EXCLUDE tag can be used to specify files and/or directories that should +# excluded from the INPUT source files. This way you can easily exclude a +# subdirectory from a directory tree whose root is specified with the INPUT tag. + +EXCLUDE = + +# The EXCLUDE_SYMLINKS tag can be used select whether or not files or directories +# that are symbolic links (a Unix filesystem feature) are excluded from the input. + +EXCLUDE_SYMLINKS = NO + +# If the value of the INPUT tag contains directories, you can use the +# EXCLUDE_PATTERNS tag to specify one or more wildcard patterns to exclude +# certain files from those directories. + +EXCLUDE_PATTERNS = + +# The EXAMPLE_PATH tag can be used to specify one or more files or +# directories that contain example code fragments that are included (see +# the \include command). + +EXAMPLE_PATH = + +# If the value of the EXAMPLE_PATH tag contains directories, you can use the +# EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp +# and *.h) to filter out the source-files in the directories. If left +# blank all files are included. + +EXAMPLE_PATTERNS = + +# If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be +# searched for input files to be used with the \include or \dontinclude +# commands irrespective of the value of the RECURSIVE tag. +# Possible values are YES and NO. If left blank NO is used. + +EXAMPLE_RECURSIVE = NO + +# The IMAGE_PATH tag can be used to specify one or more files or +# directories that contain image that are included in the documentation (see +# the \image command). + +IMAGE_PATH = + +# The INPUT_FILTER tag can be used to specify a program that doxygen should +# invoke to filter for each input file. Doxygen will invoke the filter program +# by executing (via popen()) the command , where +# is the value of the INPUT_FILTER tag, and is the name of an +# input file. Doxygen will then use the output that the filter program writes +# to standard output. + +INPUT_FILTER = + +# If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using +# INPUT_FILTER) will be used to filter the input files when producing source +# files to browse (i.e. when SOURCE_BROWSER is set to YES). + +FILTER_SOURCE_FILES = NO + +#--------------------------------------------------------------------------- +# configuration options related to source browsing +#--------------------------------------------------------------------------- + +# If the SOURCE_BROWSER tag is set to YES then a list of source files will +# be generated. Documented entities will be cross-referenced with these sources. +# Note: To get rid of all source code in the generated output, make sure also +# VERBATIM_HEADERS is set to NO. + +SOURCE_BROWSER = YES + +# Setting the INLINE_SOURCES tag to YES will include the body +# of functions and classes directly in the documentation. + +INLINE_SOURCES = NO + +# Setting the STRIP_CODE_COMMENTS tag to YES (the default) will instruct +# doxygen to hide any special comment blocks from generated source code +# fragments. Normal C and C++ comments will always remain visible. + +STRIP_CODE_COMMENTS = YES + +# If the REFERENCED_BY_RELATION tag is set to YES (the default) +# then for each documented function all documented +# functions referencing it will be listed. + +REFERENCED_BY_RELATION = YES + +# If the REFERENCES_RELATION tag is set to YES (the default) +# then for each documented function all documented entities +# called/used by that function will be listed. + +REFERENCES_RELATION = YES + +# If the VERBATIM_HEADERS tag is set to YES (the default) then Doxygen +# will generate a verbatim copy of the header file for each class for +# which an include is specified. Set to NO to disable this. + +VERBATIM_HEADERS = YES + +#--------------------------------------------------------------------------- +# configuration options related to the alphabetical class index +#--------------------------------------------------------------------------- + +# If the ALPHABETICAL_INDEX tag is set to YES, an alphabetical index +# of all compounds will be generated. Enable this if the project +# contains a lot of classes, structs, unions or interfaces. + +ALPHABETICAL_INDEX = YES + +# If the alphabetical index is enabled (see ALPHABETICAL_INDEX) then +# the COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns +# in which this list will be split (can be a number in the range [1..20]) + +COLS_IN_ALPHA_INDEX = 5 + +# In case all classes in a project start with a common prefix, all +# classes will be put under the same header in the alphabetical index. +# The IGNORE_PREFIX tag can be used to specify one or more prefixes that +# should be ignored while generating the index headers. + +IGNORE_PREFIX = + +#--------------------------------------------------------------------------- +# configuration options related to the HTML output +#--------------------------------------------------------------------------- + +# If the GENERATE_HTML tag is set to YES (the default) Doxygen will +# generate HTML output. + +GENERATE_HTML = YES + +# The HTML_OUTPUT tag is used to specify where the HTML docs will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be +# put in front of it. If left blank `html' will be used as the default path. + +HTML_OUTPUT = html + +# The HTML_FILE_EXTENSION tag can be used to specify the file extension for +# each generated HTML page (for example: .htm,.php,.asp). If it is left blank +# doxygen will generate files with .html extension. + +HTML_FILE_EXTENSION = .html + +# The HTML_HEADER tag can be used to specify a personal HTML header for +# each generated HTML page. If it is left blank doxygen will generate a +# standard header. + +HTML_HEADER = + +# The HTML_FOOTER tag can be used to specify a personal HTML footer for +# each generated HTML page. If it is left blank doxygen will generate a +# standard footer. + +HTML_FOOTER = + +# The HTML_STYLESHEET tag can be used to specify a user-defined cascading +# style sheet that is used by each HTML page. It can be used to +# fine-tune the look of the HTML output. If the tag is left blank doxygen +# will generate a default style sheet. Note that doxygen will try to copy +# the style sheet file to the HTML output directory, so don't put your own +# stylesheet in the HTML output directory as well, or it will be erased! + +HTML_STYLESHEET = + +# If the HTML_ALIGN_MEMBERS tag is set to YES, the members of classes, +# files or namespaces will be aligned in HTML using tables. If set to +# NO a bullet list will be used. + +HTML_ALIGN_MEMBERS = YES + +# If the GENERATE_HTMLHELP tag is set to YES, additional index files +# will be generated that can be used as input for tools like the +# Microsoft HTML help workshop to generate a compressed HTML help file (.chm) +# of the generated HTML documentation. + +GENERATE_HTMLHELP = NO + +# If the GENERATE_HTMLHELP tag is set to YES, the CHM_FILE tag can +# be used to specify the file name of the resulting .chm file. You +# can add a path in front of the file if the result should not be +# written to the html output directory. + +CHM_FILE = + +# If the GENERATE_HTMLHELP tag is set to YES, the HHC_LOCATION tag can +# be used to specify the location (absolute path including file name) of +# the HTML help compiler (hhc.exe). If non-empty doxygen will try to run +# the HTML help compiler on the generated index.hhp. + +HHC_LOCATION = + +# If the GENERATE_HTMLHELP tag is set to YES, the GENERATE_CHI flag +# controls if a separate .chi index file is generated (YES) or that +# it should be included in the master .chm file (NO). + +GENERATE_CHI = NO + +# If the GENERATE_HTMLHELP tag is set to YES, the BINARY_TOC flag +# controls whether a binary table of contents is generated (YES) or a +# normal table of contents (NO) in the .chm file. + +BINARY_TOC = NO + +# The TOC_EXPAND flag can be set to YES to add extra items for group members +# to the contents of the HTML help documentation and to the tree view. + +TOC_EXPAND = NO + +# The DISABLE_INDEX tag can be used to turn on/off the condensed index at +# top of each HTML page. The value NO (the default) enables the index and +# the value YES disables it. + +DISABLE_INDEX = NO + +# This tag can be used to set the number of enum values (range [1..20]) +# that doxygen will group on one line in the generated HTML documentation. + +ENUM_VALUES_PER_LINE = 4 + +# If the GENERATE_TREEVIEW tag is set to YES, a side panel will be +# generated containing a tree-like index structure (just like the one that +# is generated for HTML Help). For this to work a browser that supports +# JavaScript, DHTML, CSS and frames is required (for instance Mozilla 1.0+, +# Netscape 6.0+, Internet explorer 5.0+, or Konqueror). Windows users are +# probably better off using the HTML help feature. + +GENERATE_TREEVIEW = NO + +# If the treeview is enabled (see GENERATE_TREEVIEW) then this tag can be +# used to set the initial width (in pixels) of the frame in which the tree +# is shown. + +TREEVIEW_WIDTH = 250 + +#--------------------------------------------------------------------------- +# configuration options related to the LaTeX output +#--------------------------------------------------------------------------- + +# If the GENERATE_LATEX tag is set to YES (the default) Doxygen will +# generate Latex output. + +GENERATE_LATEX = NO + +# The LATEX_OUTPUT tag is used to specify where the LaTeX docs will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be +# put in front of it. If left blank `latex' will be used as the default path. + +LATEX_OUTPUT = latex + +# The LATEX_CMD_NAME tag can be used to specify the LaTeX command name to be +# invoked. If left blank `latex' will be used as the default command name. + +LATEX_CMD_NAME = latex + +# The MAKEINDEX_CMD_NAME tag can be used to specify the command name to +# generate index for LaTeX. If left blank `makeindex' will be used as the +# default command name. + +MAKEINDEX_CMD_NAME = makeindex + +# If the COMPACT_LATEX tag is set to YES Doxygen generates more compact +# LaTeX documents. This may be useful for small projects and may help to +# save some trees in general. + +COMPACT_LATEX = NO + +# The PAPER_TYPE tag can be used to set the paper type that is used +# by the printer. Possible values are: a4, a4wide, letter, legal and +# executive. If left blank a4wide will be used. + +PAPER_TYPE = a4wide + +# The EXTRA_PACKAGES tag can be to specify one or more names of LaTeX +# packages that should be included in the LaTeX output. + +EXTRA_PACKAGES = + +# The LATEX_HEADER tag can be used to specify a personal LaTeX header for +# the generated latex document. The header should contain everything until +# the first chapter. If it is left blank doxygen will generate a +# standard header. Notice: only use this tag if you know what you are doing! + +LATEX_HEADER = + +# If the PDF_HYPERLINKS tag is set to YES, the LaTeX that is generated +# is prepared for conversion to pdf (using ps2pdf). The pdf file will +# contain links (just like the HTML output) instead of page references +# This makes the output suitable for online browsing using a pdf viewer. + +PDF_HYPERLINKS = NO + +# If the USE_PDFLATEX tag is set to YES, pdflatex will be used instead of +# plain latex in the generated Makefile. Set this option to YES to get a +# higher quality PDF documentation. + +USE_PDFLATEX = NO + +# If the LATEX_BATCHMODE tag is set to YES, doxygen will add the \\batchmode. +# command to the generated LaTeX files. This will instruct LaTeX to keep +# running if errors occur, instead of asking the user for help. +# This option is also used when generating formulas in HTML. + +LATEX_BATCHMODE = NO + +# If LATEX_HIDE_INDICES is set to YES then doxygen will not +# include the index chapters (such as File Index, Compound Index, etc.) +# in the output. + +LATEX_HIDE_INDICES = NO + +#--------------------------------------------------------------------------- +# configuration options related to the RTF output +#--------------------------------------------------------------------------- + +# If the GENERATE_RTF tag is set to YES Doxygen will generate RTF output +# The RTF output is optimized for Word 97 and may not look very pretty with +# other RTF readers or editors. + +GENERATE_RTF = NO + +# The RTF_OUTPUT tag is used to specify where the RTF docs will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be +# put in front of it. If left blank `rtf' will be used as the default path. + +RTF_OUTPUT = rtf + +# If the COMPACT_RTF tag is set to YES Doxygen generates more compact +# RTF documents. This may be useful for small projects and may help to +# save some trees in general. + +COMPACT_RTF = NO + +# If the RTF_HYPERLINKS tag is set to YES, the RTF that is generated +# will contain hyperlink fields. The RTF file will +# contain links (just like the HTML output) instead of page references. +# This makes the output suitable for online browsing using WORD or other +# programs which support those fields. +# Note: wordpad (write) and others do not support links. + +RTF_HYPERLINKS = NO + +# Load stylesheet definitions from file. Syntax is similar to doxygen's +# config file, i.e. a series of assignments. You only have to provide +# replacements, missing definitions are set to their default value. + +RTF_STYLESHEET_FILE = + +# Set optional variables used in the generation of an rtf document. +# Syntax is similar to doxygen's config file. + +RTF_EXTENSIONS_FILE = + +#--------------------------------------------------------------------------- +# configuration options related to the man page output +#--------------------------------------------------------------------------- + +# If the GENERATE_MAN tag is set to YES (the default) Doxygen will +# generate man pages + +GENERATE_MAN = NO + +# The MAN_OUTPUT tag is used to specify where the man pages will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be +# put in front of it. If left blank `man' will be used as the default path. + +MAN_OUTPUT = man + +# The MAN_EXTENSION tag determines the extension that is added to +# the generated man pages (default is the subroutine's section .3) + +MAN_EXTENSION = .3 + +# If the MAN_LINKS tag is set to YES and Doxygen generates man output, +# then it will generate one additional man file for each entity +# documented in the real man page(s). These additional files +# only source the real man page, but without them the man command +# would be unable to find the correct page. The default is NO. + +MAN_LINKS = NO + +#--------------------------------------------------------------------------- +# configuration options related to the XML output +#--------------------------------------------------------------------------- + +# If the GENERATE_XML tag is set to YES Doxygen will +# generate an XML file that captures the structure of +# the code including all documentation. + +GENERATE_XML = NO + +# The XML_OUTPUT tag is used to specify where the XML pages will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be +# put in front of it. If left blank `xml' will be used as the default path. + +XML_OUTPUT = xml + +# The XML_SCHEMA tag can be used to specify an XML schema, +# which can be used by a validating XML parser to check the +# syntax of the XML files. + +XML_SCHEMA = + +# The XML_DTD tag can be used to specify an XML DTD, +# which can be used by a validating XML parser to check the +# syntax of the XML files. + +XML_DTD = + +# If the XML_PROGRAMLISTING tag is set to YES Doxygen will +# dump the program listings (including syntax highlighting +# and cross-referencing information) to the XML output. Note that +# enabling this will significantly increase the size of the XML output. + +XML_PROGRAMLISTING = YES + +#--------------------------------------------------------------------------- +# configuration options for the AutoGen Definitions output +#--------------------------------------------------------------------------- + +# If the GENERATE_AUTOGEN_DEF tag is set to YES Doxygen will +# generate an AutoGen Definitions (see autogen.sf.net) file +# that captures the structure of the code including all +# documentation. Note that this feature is still experimental +# and incomplete at the moment. + +GENERATE_AUTOGEN_DEF = NO + +#--------------------------------------------------------------------------- +# configuration options related to the Perl module output +#--------------------------------------------------------------------------- + +# If the GENERATE_PERLMOD tag is set to YES Doxygen will +# generate a Perl module file that captures the structure of +# the code including all documentation. Note that this +# feature is still experimental and incomplete at the +# moment. + +GENERATE_PERLMOD = NO + +# If the PERLMOD_LATEX tag is set to YES Doxygen will generate +# the necessary Makefile rules, Perl scripts and LaTeX code to be able +# to generate PDF and DVI output from the Perl module output. + +PERLMOD_LATEX = NO + +# If the PERLMOD_PRETTY tag is set to YES the Perl module output will be +# nicely formatted so it can be parsed by a human reader. This is useful +# if you want to understand what is going on. On the other hand, if this +# tag is set to NO the size of the Perl module output will be much smaller +# and Perl will parse it just the same. + +PERLMOD_PRETTY = YES + +# The names of the make variables in the generated doxyrules.make file +# are prefixed with the string contained in PERLMOD_MAKEVAR_PREFIX. +# This is useful so different doxyrules.make files included by the same +# Makefile don't overwrite each other's variables. + +PERLMOD_MAKEVAR_PREFIX = + +#--------------------------------------------------------------------------- +# Configuration options related to the preprocessor +#--------------------------------------------------------------------------- + +# If the ENABLE_PREPROCESSING tag is set to YES (the default) Doxygen will +# evaluate all C-preprocessor directives found in the sources and include +# files. + +ENABLE_PREPROCESSING = YES + +# If the MACRO_EXPANSION tag is set to YES Doxygen will expand all macro +# names in the source code. If set to NO (the default) only conditional +# compilation will be performed. Macro expansion can be done in a controlled +# way by setting EXPAND_ONLY_PREDEF to YES. + +MACRO_EXPANSION = YES + +# If the EXPAND_ONLY_PREDEF and MACRO_EXPANSION tags are both set to YES +# then the macro expansion is limited to the macros specified with the +# PREDEFINED and EXPAND_AS_PREDEFINED tags. + +EXPAND_ONLY_PREDEF = NO + +# If the SEARCH_INCLUDES tag is set to YES (the default) the includes files +# in the INCLUDE_PATH (see below) will be search if a #include is found. + +SEARCH_INCLUDES = YES + +# The INCLUDE_PATH tag can be used to specify one or more directories that +# contain include files that are not input files but should be processed by +# the preprocessor. + +INCLUDE_PATH = include + +# You can use the INCLUDE_FILE_PATTERNS tag to specify one or more wildcard +# patterns (like *.h and *.hpp) to filter out the header-files in the +# directories. If left blank, the patterns specified with FILE_PATTERNS will +# be used. + +INCLUDE_FILE_PATTERNS = + +# The PREDEFINED tag can be used to specify one or more macro names that +# are defined before the preprocessor is started (similar to the -D option of +# gcc). The argument of the tag is a list of macros of the form: name +# or name=definition (no spaces). If the definition and the = are +# omitted =1 is assumed. + +PREDEFINED = + +# If the MACRO_EXPANSION and EXPAND_ONLY_PREDEF tags are set to YES then +# this tag can be used to specify a list of macro names that should be expanded. +# The macro definition that is found in the sources will be used. +# Use the PREDEFINED tag if you want to use a different macro definition. + +EXPAND_AS_DEFINED = + +# If the SKIP_FUNCTION_MACROS tag is set to YES (the default) then +# doxygen's preprocessor will remove all function-like macros that are alone +# on a line, have an all uppercase name, and do not end with a semicolon. Such +# function macros are typically used for boiler-plate code, and will confuse the +# parser if not removed. + +SKIP_FUNCTION_MACROS = YES + +#--------------------------------------------------------------------------- +# Configuration::additions related to external references +#--------------------------------------------------------------------------- + +# The TAGFILES option can be used to specify one or more tagfiles. +# Optionally an initial location of the external documentation +# can be added for each tagfile. The format of a tag file without +# this location is as follows: +# TAGFILES = file1 file2 ... +# Adding location for the tag files is done as follows: +# TAGFILES = file1=loc1 "file2 = loc2" ... +# where "loc1" and "loc2" can be relative or absolute paths or +# URLs. If a location is present for each tag, the installdox tool +# does not have to be run to correct the links. +# Note that each tag file must have a unique name +# (where the name does NOT include the path) +# If a tag file is not located in the directory in which doxygen +# is run, you must also specify the path to the tagfile here. + +TAGFILES = + +# When a file name is specified after GENERATE_TAGFILE, doxygen will create +# a tag file that is based on the input files it reads. + +GENERATE_TAGFILE = + +# If the ALLEXTERNALS tag is set to YES all external classes will be listed +# in the class index. If set to NO only the inherited external classes +# will be listed. + +ALLEXTERNALS = NO + +# If the EXTERNAL_GROUPS tag is set to YES all external groups will be listed +# in the modules index. If set to NO, only the current project's groups will +# be listed. + +EXTERNAL_GROUPS = YES + +# The PERL_PATH should be the absolute path and name of the perl script +# interpreter (i.e. the result of `which perl'). + +PERL_PATH = /usr/bin/perl + +#--------------------------------------------------------------------------- +# Configuration options related to the dot tool +#--------------------------------------------------------------------------- + +# If the CLASS_DIAGRAMS tag is set to YES (the default) Doxygen will +# generate a inheritance diagram (in HTML, RTF and LaTeX) for classes with base or +# super classes. Setting the tag to NO turns the diagrams off. Note that this +# option is superseded by the HAVE_DOT option below. This is only a fallback. It is +# recommended to install and use dot, since it yields more powerful graphs. + +CLASS_DIAGRAMS = YES + +# If set to YES, the inheritance and collaboration graphs will hide +# inheritance and usage relations if the target is undocumented +# or is not a class. + +HIDE_UNDOC_RELATIONS = YES + +# If you set the HAVE_DOT tag to YES then doxygen will assume the dot tool is +# available from the path. This tool is part of Graphviz, a graph visualization +# toolkit from AT&T and Lucent Bell Labs. The other options in this section +# have no effect if this option is set to NO (the default) + +HAVE_DOT = NO + +# If the CLASS_GRAPH and HAVE_DOT tags are set to YES then doxygen +# will generate a graph for each documented class showing the direct and +# indirect inheritance relations. Setting this tag to YES will force the +# the CLASS_DIAGRAMS tag to NO. + +CLASS_GRAPH = YES + +# If the COLLABORATION_GRAPH and HAVE_DOT tags are set to YES then doxygen +# will generate a graph for each documented class showing the direct and +# indirect implementation dependencies (inheritance, containment, and +# class references variables) of the class with other documented classes. + +COLLABORATION_GRAPH = YES + +# If the UML_LOOK tag is set to YES doxygen will generate inheritance and +# collaboration diagrams in a style similar to the OMG's Unified Modeling +# Language. + +UML_LOOK = NO + +# If set to YES, the inheritance and collaboration graphs will show the +# relations between templates and their instances. + +TEMPLATE_RELATIONS = NO + +# If the ENABLE_PREPROCESSING, SEARCH_INCLUDES, INCLUDE_GRAPH, and HAVE_DOT +# tags are set to YES then doxygen will generate a graph for each documented +# file showing the direct and indirect include dependencies of the file with +# other documented files. + +INCLUDE_GRAPH = YES + +# If the ENABLE_PREPROCESSING, SEARCH_INCLUDES, INCLUDED_BY_GRAPH, and +# HAVE_DOT tags are set to YES then doxygen will generate a graph for each +# documented header file showing the documented files that directly or +# indirectly include this file. + +INCLUDED_BY_GRAPH = YES + +# If the CALL_GRAPH and HAVE_DOT tags are set to YES then doxygen will +# generate a call dependency graph for every global function or class method. +# Note that enabling this option will significantly increase the time of a run. +# So in most cases it will be better to enable call graphs for selected +# functions only using the \callgraph command. + +CALL_GRAPH = NO + +# If the GRAPHICAL_HIERARCHY and HAVE_DOT tags are set to YES then doxygen +# will graphical hierarchy of all classes instead of a textual one. + +GRAPHICAL_HIERARCHY = YES + +# The DOT_IMAGE_FORMAT tag can be used to set the image format of the images +# generated by dot. Possible values are png, jpg, or gif +# If left blank png will be used. + +DOT_IMAGE_FORMAT = png + +# The tag DOT_PATH can be used to specify the path where the dot tool can be +# found. If left blank, it is assumed the dot tool can be found on the path. + +DOT_PATH = + +# The DOTFILE_DIRS tag can be used to specify one or more directories that +# contain dot files that are included in the documentation (see the +# \dotfile command). + +DOTFILE_DIRS = + +# The MAX_DOT_GRAPH_WIDTH tag can be used to set the maximum allowed width +# (in pixels) of the graphs generated by dot. If a graph becomes larger than +# this value, doxygen will try to truncate the graph, so that it fits within +# the specified constraint. Beware that most browsers cannot cope with very +# large images. + +MAX_DOT_GRAPH_WIDTH = 1024 + +# The MAX_DOT_GRAPH_HEIGHT tag can be used to set the maximum allows height +# (in pixels) of the graphs generated by dot. If a graph becomes larger than +# this value, doxygen will try to truncate the graph, so that it fits within +# the specified constraint. Beware that most browsers cannot cope with very +# large images. + +MAX_DOT_GRAPH_HEIGHT = 1024 + +# The MAX_DOT_GRAPH_DEPTH tag can be used to set the maximum depth of the +# graphs generated by dot. A depth value of 3 means that only nodes reachable +# from the root by following a path via at most 3 edges will be shown. Nodes that +# lay further from the root node will be omitted. Note that setting this option to +# 1 or 2 may greatly reduce the computation time needed for large code bases. Also +# note that a graph may be further truncated if the graph's image dimensions are +# not sufficient to fit the graph (see MAX_DOT_GRAPH_WIDTH and MAX_DOT_GRAPH_HEIGHT). +# If 0 is used for the depth value (the default), the graph is not depth-constrained. + +MAX_DOT_GRAPH_DEPTH = 0 + +# If the GENERATE_LEGEND tag is set to YES (the default) Doxygen will +# generate a legend page explaining the meaning of the various boxes and +# arrows in the dot generated graphs. + +GENERATE_LEGEND = YES + +# If the DOT_CLEANUP tag is set to YES (the default) Doxygen will +# remove the intermediate dot files that are used to generate +# the various graphs. + +DOT_CLEANUP = YES + +#--------------------------------------------------------------------------- +# Configuration::additions related to the search engine +#--------------------------------------------------------------------------- + +# The SEARCHENGINE tag specifies whether or not a search engine should be +# used. If set to NO the values of all tags below this one will be ignored. + +SEARCHENGINE = NO diff --git a/livesupport/modules/archiveServer/var/Archive.php b/livesupport/modules/archiveServer/var/Archive.php new file mode 100644 index 000000000..a36dee141 --- /dev/null +++ b/livesupport/modules/archiveServer/var/Archive.php @@ -0,0 +1,157 @@ +accessRawAudioData($sessid, $gunid); + if(PEAR::isError($lnk)) return $lnk; + // return tmpurl, fname, md5h + $url = $this->_lnk2url($lnk); + $md5h = $this->_md5sum($lnk); + return array('url'=>$url, 'md5h'=>$md5h, 'fname'=>basename($lnk)); + } + + + /** + * Close download + */ + function downloadClose($sessid, $url) + { + // release + $lnk = $this->_url2lnk($url); + $res = $this->releaseRawAudioData($sessid, $lnk); + return $res; + } + + + /** + * Open upload + */ + function uploadOpen($sessid, $gunid) + { + $fname = "{$this->storageDir}/buffer/$gunid"; + if(!$fp = fopen($fname, 'w')) return PEAR::raiseError( + "Archive::uploadOpen: unable to create blank file" + ); + fclose($fp); + $res = $this->storeAudioClip($sessid, $gunid, $fname, ''); + if(PEAR::isError($res)) return $res; + $lnk = $this->accessRawAudioData($sessid, $gunid); + if(PEAR::isError($lnk)) return $lnk; + $url = $this->_lnk2url($lnk); + return array('url'=>$url); + } + + + /** + * Abort upload + */ + function uploadAbort($sessid, $url) + { + $lnk = $this->_url2lnk($url); + $res = $this->releaseRawAudioData($sessid, $lnk); + return $res; + } + + + /** + * Check upload + */ + function uploadCheck($sessid, $url) + { + $lnk = $this->_url2lnk($url); + $md5h = $this->_md5sum($lnk); + $size = filesize($lnk); + return array('md5h'=>$md5h, 'size'=>$size, 'url'=>$url); + } + + + /** + * Close upload + */ + function uploadClose($sessid, $url, $type='file') + { + switch($type){ + default: // case"file": + // release + $lnk = $this->_url2lnk($url); + $res = $this->releaseRawAudioData($sessid, $lnk); + return $res; + break; + case"search": + // localSearch + // return results + break; + } + } + + /** + * Translate local symlink to URL + * + */ + function _lnk2url($lnk) + { + return "http://{$this->config['archiveUrlHost']}:{$this->config['archiveUrlPort']}". + "{$this->config['archiveUrlPath']}/access/".basename($lnk); + } + + /** + * Traslate URL to local symlink + * + */ + function _url2lnk($url) + { + return $this->accessDir."/".basename($url); + } + function _md5sum($fpath) + { + $md5h = `md5sum $fpath`; + $arr = split(' ', $md5h); + return $arr[0]; + } +} +?> \ No newline at end of file diff --git a/livesupport/modules/archiveServer/var/conf.php b/livesupport/modules/archiveServer/var/conf.php new file mode 100644 index 000000000..af580d0be --- /dev/null +++ b/livesupport/modules/archiveServer/var/conf.php @@ -0,0 +1,63 @@ + array( + 'username' => 'test', + 'password' => 'test', + 'hostspec' => 'localhost', +# 'hostspec' => '127.0.0.1', // for bad resolver + 'phptype' => 'pgsql', + 'database' => 'LiveSupport-test', + ), + 'tblNamePrefix' => 'as_', + 'authCookieName'=> 'assid', + 'RootNode' => 'RootNode', + 'tmpRootPass' => 'q', + 'objtypes' => array( + 'RootNode' => array('Folder'), + 'Storage' => array('Folder', 'File', 'Replica'), + 'Folder' => array('Folder', 'File', 'Replica'), + 'File' => array(), + 'Replica' => array(), + ), + 'allowedActions'=> array( + 'RootNode' => array('classes', 'subjects'), + 'Folder' => array('editPrivs', 'write', 'read'), + 'File' => array('editPrivs', 'write', 'read'), + 'Replica' => array('editPrivs', 'write', 'read'), + '_class' => array('editPrivs', 'write', 'read'), + ), + 'allActions' => array( + 'editPrivs', 'write', 'read', 'classes', 'subjects' + ), + 'storageDir' => dirname(getcwd()).'/stor', + 'accessDir' => dirname(getcwd()).'/access', +); +?> \ No newline at end of file diff --git a/livesupport/modules/archiveServer/var/html/default.css b/livesupport/modules/archiveServer/var/html/default.css new file mode 100644 index 000000000..a065ef231 --- /dev/null +++ b/livesupport/modules/archiveServer/var/html/default.css @@ -0,0 +1,19 @@ + diff --git a/livesupport/modules/archiveServer/var/html/gbHtmlBrowse.php b/livesupport/modules/archiveServer/var/html/gbHtmlBrowse.php new file mode 100644 index 000000000..d0c40e0f0 --- /dev/null +++ b/livesupport/modules/archiveServer/var/html/gbHtmlBrowse.php @@ -0,0 +1,245 @@ +\n"; print_r($_FILES); print_r($_REQUEST); print_r($_SERVER); exit; +require_once"gbHtml_h.php"; +require_once"gbHtmlTestAuth.php"; + +$fldsname=array('author'=>'Author', 'title'=>'Title', 'creator'=>'Creator', + 'description'=>'Description', 'subject'=>'Subject', 'genre'=>'Genre'); + +$sessid = $_REQUEST[$config['authCookieName']]; +$userid = $gb->getSessUserId($sessid); +$login = $gb->getSessLogin($sessid); + +#$path = ($_REQUEST['path']=='' ? '/' : $_REQUEST['path']); +$id = (!$_REQUEST['id'] ? $gb->storId : $_REQUEST['id']); + +#echo"
\nsessid=$sessid\nuserid=$userid\nlogin=$login\n"; exit;
+
+$tpldata = array(
+    'msg'       => $_SESSION['alertMsg'],
+    'loggedAs'  => $login,
+    'id'        => $id,
+); unset($_SESSION['alertMsg']);
+
+switch($_REQUEST['act']){
+    case"getHomeDir":
+        $id = $gb->getObjId($login, $gb->storId);
+        $tpldata['id'] = $id;
+    default:
+#        echo"
\n$path\n$upath
\n"; print_r($_FILES); print_r($_REQUEST); exit;
+        $tpldata=array_merge($tpldata, array(
+            'pathdata'  => $gb->getPath($id, $sessid),
+            'listdata'  => ($gb->getObjType($id)=='Folder'?
+                $gb->listFolder($id, $sessid):array()
+            ),
+            'tree'  => ($_REQUEST['tree']=='Y'),
+            'showPath'  => true,
+            'showTree'  => true,
+        ));
+        if($_REQUEST['tree']=='Y'){
+            $tpldata['treedata'] = $gb->getSubTree($id, $sessid);
+        }
+        break;
+    case"newfile":
+        $tpldata=array(
+            'pathdata'  => $gb->getPath($id, $sessid),
+            'showEdit'  => true,
+            'id'    => $id,
+        );
+        break;
+    case"sform":
+        $tpldata=array(
+#            'pathdata'  => $gb->getPath($path, $sessid),
+            'showSForm'  => true,
+            'id'    => $id,
+        );
+        break;
+    case"search":
+        $tpldata=array(
+#            'pathdata'  => $gb->getPath($path, $sessid),
+            'search'  => $gb->localSearch($_REQUEST['srch'], $sessid),
+            'showSRes'  => true,
+            'id'    => $id,
+        );
+        break;
+}
+
+if(PEAR::isError($tpldata['listdata'])){
+    $tpldata['msg'] = $tpldata['listdata']->getMessage();
+    $tpldata['listdata'] = array();
+}
+#echo"
\n$path
\n"; print_r($tpldata['pathdata']); print_r($tpldata); exit;
+
+$tpldata['showMenu']=true;
+
+
+// =================== template: =================== 
+
+?>
+
+Browser
+
+
+
+
+
+
+
+
+

+ Home directory
+ Upload new file
+ Create new folder
+ Search
+

+
+
+
+ 

+    Tree  
+    
+        
+        /
+    :
+    
+        permissions
+    
+ 

+
+
+
+ 
+    
+    
+    

+ 
+
+ 
+ 
+    
+   
+ 
+  
+ 
+ 

+    href="gbHtmlBrowse.php?id=">
+    
+    'D', 'File'=>'F', 'Replica'=>'R'); echo$a[$o['type']]?>
+     rename
+     move
+     copy
+
+     replicate
+
+     permissions
+     DEL
+    
+     Access
+     Analyze
+     MetaData
+    
+    
+      (->)
+    
+    
No objects

+
+
+
+

+?>
+
+ 
+ 
+ 
+
+ 
+
+ 
+
File name:
Media file:
Metadata file:

+    
+ 

+
+
+
+

+
+
+
+

+
+ 
+ 
+
Search string:

+
+
+

+
+
+
+
    
+$v){?>
+ 
  • 
+
+ No items found
+
+

+
+
+
+
+
+
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/gbHtmlLogin.php b/livesupport/modules/archiveServer/var/html/gbHtmlLogin.php
new file mode 100644
index 000000000..888a533c6
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHtmlLogin.php
@@ -0,0 +1,73 @@
+ $gb->getSubjects(),
+    'actions'   => $gb->getAllActions(),
+    'objects'   => $gb->getAllObjects(),
+    'msg'       => $_SESSION['alertMsg']
+);
+unset($_SESSION['alertMsg']);
+
+// forms prefill:
+if(is_array($_SESSION['lastPost'])) $d = array_merge($d, array(
+    'lastSubj'  => $_SESSION['lastPost']['subj'],
+    'lastAction'=> $_SESSION['lastPost']['permAction'],
+    'lastObj'   => $_SESSION['lastPost']['obj']
+));
+unset($_SESSION['lastPost']);
+
+#header("Content-type: text/plain"); print_r($d); exit;
+#require_once"gbHtml_f.php";
+// template follows:
+?>
+
+Storage - login
+
+
+
+
+
+

+ Test accounts/pass:
+ 
+

+
+
Storage - login

+
+

+
+
+
+
+
Login:
Password:

+
+

+

+
+
+
+
+
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/gbHtmlPerms.php b/livesupport/modules/archiveServer/var/html/gbHtmlPerms.php
new file mode 100644
index 000000000..af2e286b6
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHtmlPerms.php
@@ -0,0 +1,111 @@
+getSessUserId($_REQUEST[$config['authCookieName']]);
+$login = $gb->getSessLogin($_REQUEST[$config['authCookieName']]);
+
+$id = (!$_REQUEST['id'] ? $gb->storId : $_REQUEST['id']);
+
+#header("Content-type: text/plain"); print_r($_REQUEST); exit;
+#header("Content-type: text/plain"); echo $gb->dumpTree($id, '    ')."\n"; exit;
+
+// prefill data structure for template
+$tpldata = array(
+    'pathdata'  => $gb->getPath($id),
+    'perms'     => $gb->getObjPerms($id),
+    'actions'   => $gb->getAllowedActions($gb->getObjType($id)),
+    'subjects'  => $gb->getSubjects(),
+    'id'        => $id,
+    'loggedAs'  => $login,
+);
+$tpldata['msg'] = $_SESSION['alertMsg']; unset($_SESSION['alertMsg']);
+
+#header("Content-type: text/plain"); print_r($tpldata); exit;
+
+
+#require_once"gbHtml_f.php";
+// template follows:
+?>
+
+Storage - permission editor
+
+
+
+
+
+    
+
Permission editor

+
+
Path:
+ $it) {?>
+  /
+ 
+
+

+
+
+
+0) foreach($tpldata['perms'] as $k=>$row) {
+    $da=($row['type']=='A' ? 'allow' : ($row['type']=='D' ? 'deny' : $row['type']));?>
+  
+    
+    
+    
+    
+  
+
+ 
+
+
subject nameactionpermission
>
+     remove
+    
none

+
+

+Add permission
+
+for action
+
+to subject
+
+
+
+
+

+
+
+
+
+
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/gbHtmlSubj.php b/livesupport/modules/archiveServer/var/html/gbHtmlSubj.php
new file mode 100644
index 000000000..6039953d3
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHtmlSubj.php
@@ -0,0 +1,162 @@
+listGroup($id)); exit;
+
+// prefill data structure for template
+switch($type){
+    case "list":
+        $d = array(
+            'subj'       => $gb->getSubjectsWCnt(),
+            'loggedAs'  => $login
+        );
+        break;
+    case "group":
+        $d = array(
+            'rows'      => $gb->listGroup($id),
+            'id'        => $id,
+            'loggedAs'  => $login,
+            'gname'     => $gb->getSubjName($id),
+            'subj'       => $gb->getSubjects()
+        );
+        break;
+    case "passwd":
+        break;
+    default:
+}
+$d['msg'] = $_SESSION['alertMsg']; unset($_SESSION['alertMsg']);
+
+#header("Content-type: text/plain"); print_r($d); echo($list ? 'Y' : 'N')."\n"; exit;
+#require_once"gbHtml_f.php";
+// template follows:
+?>
+
+Storage - user and roles editor
+
+
+
+
+
+    
+
User/Group editor

+
+
+
Subjects:

+
+
+0) foreach($d['subj'] as $k=>$c) {?>
+  
+    
+    (G:) (U)
+    
+  
+
+ 
+
+
idloginuser/group

+        
+            
+        
+        
+     
+     remove
+     change password
+    
none

+
+

+Add subject with name:  
+[and password:  ]
+
+
+

+
+
+
+
Subjects in group :

+
+
+  
+    
+  
+0) foreach($d['rows'] as $k=>$row) {?>
+  
+    
+     (G) (U)
+    
+  
+
+ 
+
+

+        All subjects
+    

+        
+            
+        
+        
+     
+     
+        removeFromGroup
+     
+    
none

+
+

+Add subject
+
+to group 
+
+
+
+
+

+
+
+

+
+
+
+
+
+
Old password:
New password:
Retype:

+
+
+

+
+
+
+
+
+
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/gbHtmlTestAuth.php b/livesupport/modules/archiveServer/var/html/gbHtmlTestAuth.php
new file mode 100644
index 000000000..70da09b9b
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHtmlTestAuth.php
@@ -0,0 +1,9 @@
+getSessLogin($_REQUEST[$config['authCookieName']]);
+if(!isset($login)||$login==''){
+    $_SESSION['alertMsg'] = "Login required";
+    header("Location: gbHtmlLogin.php");
+    exit;
+}
+?>
diff --git a/livesupport/modules/archiveServer/var/html/gbHtmlTestData.php b/livesupport/modules/archiveServer/var/html/gbHtmlTestData.php
new file mode 100644
index 000000000..eb50120dd
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHtmlTestData.php
@@ -0,0 +1,13 @@
+initDb();
+$gb->init();
+#system("rm -f {$config['storageDir']}/*.bin {$config['storageDir']}/*.xml");
+$d = $gb->testData();
+$gb->putFile('/folder1/folder1_2/folder1_2_1', 'fileA', "123\n345\n", "", 'at');
+$gb->createReplica('/folder1/folder1_2/folder1_2_1/fileA', '/folder1/folder1_2/folder1_2_1', 'replFA', 'at');
+$gb->putFile('/folder1/folder1_2/folder1_2_1', 'fileB', "123\n345\n789\n", "", 'at');
+$gb->ovewriteMetadata('/folder1/folder1_2/folder1_2_1/fileA', "\n", 'at');
+
+$gb->deleteFile('/folder1/folder1_2/folder1_2_1/fileB', 'at');
+
+?>
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/gbHtml_h.php b/livesupport/modules/archiveServer/var/html/gbHtml_h.php
new file mode 100644
index 000000000..e6630f8d8
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHtml_h.php
@@ -0,0 +1,25 @@
+gm:\n".$err->getMessage()."\ndi:\n".$err->getDebugInfo()."\nui:\n".$err->getUserInfo()."\n";
+    echo "
BackTrace:\n";
+    print_r($err->backtrace);
+    echo "
\n";
+    exit;
+}
+
+$dbc = DB::connect($config['dsn'], TRUE);
+$dbc->setFetchMode(DB_FETCHMODE_ASSOC);
+$gb = &new GreenBox(&$dbc, $config);
+
+?>
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/gbHttp.php b/livesupport/modules/archiveServer/var/html/gbHttp.php
new file mode 100644
index 000000000..d17b608ab
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/gbHttp.php
@@ -0,0 +1,197 @@
+\n"; print_r($_SERVER); exit;
+
+define('BROWSER', "gbHtmlBrowse.php");
+
+
+$sessid = $_REQUEST[$config['authCookieName']];
+$userid = $gb->getSessUserId($sessid);
+$login = $gb->getSessLogin($sessid);
+
+#$path = ($_REQUEST['path']=='' ? '/' : $_REQUEST['path']);
+#$upath = urlencode($path);
+#$id = $gb->_idFromPath($path);
+$id = (!$_REQUEST['id'] ? $gb->storId : $_REQUEST['id']);
+
+
+#if(PEAR::isError($id)){ $_SESSION['msg'] = $id->getMessage(); header("Location: ".BROWSER."?id=$id"); exit; }
+$redirUrl="gbHtmlBrowse.php?id=$id";
+
+switch($_REQUEST['act']){
+// --- authentication ---
+    case"login";
+#        echo"
\n"; print_r($_REQUEST); exit;
+        $sessid = $gb->login($_REQUEST['login'], $_REQUEST['pass']);
+        if($sessid && !PEAR::isError($sessid)){
+#            echo"
$sessid\n"; print_r($_REQUEST); exit;
+            setcookie($config['authCookieName'], $sessid);
+            $redirUrl="gbHtmlBrowse.php";
+            $fid = $gb->getObjId($_REQUEST['login'], $gb->storId);
+            if(!PEAR::isError($fid)) $redirUrl.="?id=$fid";
+        }else{ $redirUrl="gbHtmlLogin.php"; $_SESSION['alertMsg']='Login failed.'; }
+#        echo"
$redirUrl\n"; print_r($_REQUEST); exit;
+    break;
+    case"logout";
+        $gb->logout($sessid);
+        setcookie($config['authCookieName'], '');
+        $redirUrl="gbHtmlLogin.php";
+    break;
+
+// --- files ---
+    case"upload":
+        $tmpgunid = md5(microtime().$_SERVER['SERVER_ADDR'].rand()."org.mdlf.livesupport");
+        $ntmp = "{$gb->storageDir}/buffer/$tmpgunid";
+#        $ntmp = tempnam(""{$gb->storageDir}/buffer", 'gbTmp_');
+        $mdtmp = "";
+        move_uploaded_file($_FILES['mediafile']['tmp_name'], $ntmp); chmod($ntmp, 0664);
+        if($_FILES['mdatafile']['tmp_name']){
+            $mdtmp = "$ntmp.xml";
+            if(move_uploaded_file($_FILES['mdatafile']['tmp_name'], $mdtmp)){
+                chmod($mdtmp, 0664);
+            }
+        }
+        $r = $gb->putFile($id, $_REQUEST['filename'], $ntmp, $mdtmp, $sessid);
+        if(PEAR::isError($r)) $_SESSION['alertMsg'] = $r->getMessage();
+        else{
+#            $gb->updateMetadataDB($gb->_pathFromId($r), $mdata, $sessid);
+            @unlink($ntmp);
+            @unlink($mdtmp);
+        }
+        $redirUrl = BROWSER."?id=$id";
+    break;
+    case"newFolder":
+        $r = $gb->createFolder($id, $_REQUEST['newname'], $sessid);
+        if(PEAR::isError($r)) $_SESSION['alertMsg'] = $r->getMessage();
+        $redirUrl = BROWSER."?id=$id";
+    break;
+    case"rename":
+        $parid = $gb->getparent($id);
+        $r = $gb->renameFile($id, $_REQUEST['newname'], $sessid);
+        if(PEAR::isError($r)) $_SESSION['alertMsg'] = $r->getMessage();
+        $redirUrl = BROWSER."?id=$parid";
+    break;
+    case"move":
+        $newPath = urlencode($_REQUEST['newPath']);
+        $did = $gb->getObjIdFromRelPath($id, $newPath);
+        $parid = $gb->getparent($id);
+        $r = $gb->moveFile($id, $did, $sessid);
+        if(PEAR::isError($r)){
+            $_SESSION['alertMsg'] = $r->getMessage();
+            $redirUrl = BROWSER."?id=$parid";
+        }
+        else $redirUrl = BROWSER."?id=$did";
+    break;
+    case"copy":
+        $newPath = urldecode($_REQUEST['newPath']);
+        $did = $gb->getObjIdFromRelPath($id, $newPath);
+        $parid = $gb->getparent($id);
+#        echo"
\n$id\t$newPath\t$did\n"; print_r($did); exit;
+        $r = $gb->copyFile($id, $did, $sessid);
+        if(PEAR::isError($r)){
+            $_SESSION['alertMsg'] = $r->getMessage();
+            $redirUrl = BROWSER."?id=$parid";
+        }
+        else $redirUrl = BROWSER."?id=$did";
+    break;
+/* NOT WORKING - sorry
+    case"repl":
+        $unewpath = urlencode($_REQUEST['newpath']);
+        $r = $gb->createReplica($id, $_REQUEST['newpath'], '', $sessid);
+        if(PEAR::isError($r)) $_SESSION['alertMsg'] = $r->getMessage();
+        $redirUrl = BROWSER."?id=$newparid";
+    break;
+*/
+    case"delete":
+        $parid = $gb->getparent($id);
+        $r = $gb->deleteFile($id, $sessid);
+        if(PEAR::isError($r)) $_SESSION['alertMsg'] = $r->getMessage();
+        $redirUrl = BROWSER."?id=$parid";
+    break;
+    case"getFile":
+#        echo"
$t, $ctype\n"; exit;
+#        $r = $gb->getFile($id, $sessid);
+        $r = $gb->access($id, $sessid);
+        if(PEAR::isError($r)) $_SESSION['alertMsg'] = $r->getMessage();
+        else echo $r;
+        exit;
+    break;
+    case"getMdata":
+        header("Content-type: text/xml");
+        $r = $gb->getMdata($id, $sessid);
+        print_r($r);
+        exit;
+    break;
+    case"getInfo":
+        header("Content-type: text/plain");
+        $ia = $gb->analyzeFile($id, $sessid);
+        echo"fileformat: {$ia['fileformat']}\n";
+        echo"channels: {$ia['audio']['channels']}\n";
+        echo"sample_rate: {$ia['audio']['sample_rate']}\n";
+        echo"bits_per_sample: {$ia['audio']['bits_per_sample']}\n";
+        echo"channelmode: {$ia['audio']['channelmode']}\n";
+        echo"title: {$ia['id3v1']['title']}\n";
+        echo"artist: {$ia['id3v1']['artist']}\n";
+        echo"comment: {$ia['id3v1']['comment']}\n";
+#        echo": {$ia['id3v1']['']}\n";
+#        print_r($ia);
+        exit;
+    break;
+
+// --- subjs ----
+    case"addSubj";
+        $redirUrl="gbHtmlSubj.php";
+        if($gb->checkPerm($userid, 'subjects'))
+            $res = $gb->addSubj($_REQUEST['login'], ($_REQUEST['pass']=='' ? NULL:$_REQUEST['pass'] ));
+        else{ $_SESSION['alertMsg']='Access denied.'; break; }
+        if(PEAR::isError($res)) $_SESSION['alertMsg'] = $res->getMessage();
+    break;
+    case"removeSubj";
+        $redirUrl="gbHtmlSubj.php";
+        if($gb->checkPerm($userid, 'subjects'))
+            $res = $gb->removeSubj($_REQUEST['login']);
+        else{ $_SESSION['alertMsg']='Access denied.'; break; }
+        if(PEAR::isError($res)) $_SESSION['alertMsg'] = $res->getMessage();
+    break;
+    case"passwd";
+        $redirUrl="gbHtmlSubj.php";
+        $ulogin = $gb->getSubjName($_REQUEST['uid']);
+        if($userid != $_REQUEST['uid'] &&
+            ! $gb->checkPerm($userid, 'subjects')){
+            $_SESSION['alertMsg']='Access denied..';
+            break;
+        }
+        if(FALSE === $gb->authenticate($ulogin, $_REQUEST['oldpass'])){
+            $_SESSION['alertMsg']='Wrong old pasword.';
+            break;
+        }
+        if($_REQUEST['pass'] !== $_REQUEST['pass2']){
+            $_SESSION['alertMsg']="Passwords do not match. ({$_REQUEST['pass']}/{$_REQUEST['pass2']})";
+            break;
+        }
+        $gb->passwd($ulogin, $_REQUEST['oldpass'], $_REQUEST['pass']);
+    break;
+
+// --- perms ---
+    case"addPerm";
+        if($gb->checkPerm($userid, 'editPerms', $_REQUEST['id']))
+            $gb->addPerm($_REQUEST['subj'], $_REQUEST['permAction'], $_REQUEST['id'], $_REQUEST['allowDeny']);
+        else $_SESSION['alertMsg']='Access denied.';
+        $redirUrl="gbHtmlPerms.php?id=$id";
+    break;
+    case"removePerm";
+        if($gb->checkPerm($userid, 'editPerms', $_REQUEST['oid']))
+            $gb->removePerm($_GET['permid']);
+        else $_SESSION['alertMsg']='Access denied.';
+        $redirUrl="gbHtmlPerms.php?id=$id";
+    break;
+
+    default:
+        $_SESSION['alertMsg']="Unknown method: {$_REQUEST['act']}";
+        $redirUrl="gbHtmlLogin.php";
+}
+
+#echo"
$redirUrl\n"; print_r($_REQUEST); exit;
+header("Location: $redirUrl");
+?>
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/html/index.php b/livesupport/modules/archiveServer/var/html/index.php
new file mode 100644
index 000000000..47a34380e
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/html/index.php
@@ -0,0 +1,34 @@
+
diff --git a/livesupport/modules/archiveServer/var/index.php b/livesupport/modules/archiveServer/var/index.php
new file mode 100644
index 000000000..200ad3e62
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/index.php
@@ -0,0 +1,45 @@
+
+
+ArchiveServer module
+
+
ArchiveServer module

+

+HTML client

+XmlRpc test

+Test

+
+
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/install/index.php b/livesupport/modules/archiveServer/var/install/index.php
new file mode 100644
index 000000000..534bacd18
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/install/index.php
@@ -0,0 +1,34 @@
+
diff --git a/livesupport/modules/archiveServer/var/install/install.php b/livesupport/modules/archiveServer/var/install/install.php
new file mode 100644
index 000000000..4285a326d
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/install/install.php
@@ -0,0 +1,91 @@
+getMessage()."\ndi:\n".$err->getDebugInfo()."\nui:\n".$err->getUserInfo()."\n
\n";
+    exit;
+}
+
+
+PEAR::setErrorHandling(PEAR_ERROR_PRINT, "%s
\n");
+$dbc = DB::connect($config['dsn'], TRUE);
+if(PEAR::isError($dbc)){
+    echo "Database connection problem.\n";
+    echo "Check if database '{$config['dsn']['database']}' exists with corresponding permissions.\n";
+    echo "Database access is defined by 'dsn' values in conf.php.\n";
+    exit;
+}
+
+$dbc->setFetchMode(DB_FETCHMODE_ASSOC);
+$gb = &new GreenBox(&$dbc, $config);
+
+echo "\nIMPORTANT settings:\n";
+echo " Makefile: HTTP_GROUP - group of running http daemon\n";
+echo " var/xmlrpc/testRunner.sh: XMLRPC - URL of XMLRPC server\n\n";
+
+echo "Archive: Install ...\n";
+$dbc->setErrorHandling(PEAR_ERROR_RETURN);
+$gb->uninstall();
+PEAR::setErrorHandling(PEAR_ERROR_PRINT, "%s
\n");
+$gb->install();
+
+echo " Testing ...\n";
+$gb->test();
+$log = $gb->test_log;
+echo " TESTS:\n$log\n---\n";
+
+#echo " Reinstall + testdata insert ...\n";
+#$gb->reinstall();
+#$gb->sessid = $gb->login('root', $gb->config['tmpRootPass']);
+#$gb->testData();
+#$gb->logout($gb->sessid); unset($gb->sessid);
+
+echo " TREE DUMP:\n";
+echo $gb->dumpTree();
+
+echo " Delete test data ...\n";
+$gb->deleteData();
+
+if(!($fp = @fopen($config['storageDir']."/_writeTest", 'w')))
+    echo "\n!!! make {$config['storageDir']} dir webdaemon-writeable !!!\nand run install again\n\n";
+else{
+    fclose($fp); unlink($config['storageDir']."/_writeTest");
+    echo "\nArchive is probably installed OK\n";
+}
+
+$dbc->disconnect();
+?>
diff --git a/livesupport/modules/archiveServer/var/install/uninstall.php b/livesupport/modules/archiveServer/var/install/uninstall.php
new file mode 100644
index 000000000..30abf5257
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/install/uninstall.php
@@ -0,0 +1,61 @@
+getMessage()."\ndi:\n".$err->getDebugInfo()."\nui:\n".$err->getUserInfo()."\n
\n";
+    exit;
+}
+
+
+PEAR::setErrorHandling(PEAR_ERROR_PRINT, "%s
\n");
+$dbc = DB::connect($config['dsn'], TRUE);
+if(PEAR::isError($dbc)){
+    echo "Database connection problem.\n";
+    echo "Check if database '{$config['dsn']['database']}' exists with corresponding permissions.\n";
+    echo "Database access is defined by 'dsn' values in conf.php.\n";
+    exit;
+}
+
+$dbc->setFetchMode(DB_FETCHMODE_ASSOC);
+$gb = &new GreenBox(&$dbc, $config);
+
+#    $dbc->setErrorHandling(PEAR_ERROR_RETURN);
+echo "Trying to uninstall Archive ...\n";
+$gb->uninstall();
+
+$dbc->disconnect();
+?>
diff --git a/livesupport/modules/archiveServer/var/xmlrpc/testRunner.sh b/livesupport/modules/archiveServer/var/xmlrpc/testRunner.sh
new file mode 100755
index 000000000..0096289fc
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/xmlrpc/testRunner.sh
@@ -0,0 +1,105 @@
+#!/bin/sh
+
+#-------------------------------------------------------------------------------
+#   Copyright (c) 2004 Media Development Loan Fund
+#
+#   This file is part of the LiveSupport project.
+#   http://livesupport.campware.org/
+#   To report bugs, send an e-mail to bugs@campware.org
+#
+#   LiveSupport is free software; you can redistribute it and/or modify
+#   it under the terms of the GNU General Public License as published by
+#   the Free Software Foundation; either version 2 of the License, or
+#   (at your option) any later version.
+#
+#   LiveSupport is distributed in the hope that it will be useful,
+#   but WITHOUT ANY WARRANTY; without even the implied warranty of
+#   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#   GNU General Public License for more details.
+#
+#   You should have received a copy of the GNU General Public License
+#   along with LiveSupport; if not, write to the Free Software
+#   Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
+#
+#
+#   Author   : $Author: tomas $
+#   Version  : $Revision: 1.1 $
+#   Location : $Source: /home/paul/cvs2svn-livesupport/newcvsrepo/livesupport/modules/archiveServer/var/xmlrpc/testRunner.sh,v $
+#-------------------------------------------------------------------------------
+
+COMM=$1
+shift
+GUNID=$1
+
+XMLRPC=http://localhost:80/livesupport/modules/archiveServer/var/xmlrpc/xrArchive.php
+echo "XMLRPC server URL (check it in troubles):"
+echo $XMLRPC
+
+TESTDIR=`dirname $0`
+XR_CLI="$TESTDIR/xr_cli_test.py -s $XMLRPC"
+
+login() {
+    echo "login:"
+    SESSID=`$XR_CLI login root q`
+    echo "sessid: $SESSID"
+}
+
+ping() {
+    echo "ping:"
+    $XR_CLI ping abcDef
+}
+
+# existsAudioClip() {
+#     echo "existsAudioClip:"
+#     $XR_CLI existsAudioClip $SESSID $GUNID
+# }
+
+downloadOpenClose() {
+    echo "downloadOpen:"
+    FURL=`$XR_CLI downloadOpen $SESSID $GUNID`
+    FURL=""
+    FURL=`echo "$FURL" | php -q`
+    echo $FURL
+#    ls -l `dirname $FURL`
+    echo "downloadClose:"
+    $XR_CLI downloadClose $SESSID $FURL
+#$XR_CLI getAudioClip $SESSID $GUNID
+}
+
+# storeAudioClip() {
+#     echo "storeAudioClip:"
+#     MEDIA=../tests/ex1.mp3
+#     METADATA=../tests/testStorage.xml
+#     RGUNID=`$XR_CLI storeAudioClip "$SESSID" 'X' "$MEDIA" "$METADATA"`
+#     echo $RGUNID
+# }
+
+# searchMetadata() {
+#     echo "searchMetadata:"
+# #    $XR_CLI searchMetadata $SESSID '../tests/srch_cri1.xml'
+#     $XR_CLI searchMetadata $SESSID 'John %'
+# }
+
+logout() {
+    echo "logout:"
+    $XR_CLI logout $SESSID
+}
+
+usage(){
+    echo "Usage: $0  [args]"
+    echo -e "commands:\n test, ...\n"
+}
+
+if [ "$COMM" == "ping" ]; then
+    ping
+elif [ "x$COMM" == "x" ]; then
+#    echo "No action"
+    login
+    downloadOpenClose
+    logout
+elif [ "$COMM" == "help" ]; then
+    usage
+else
+    echo "Unknown command"
+    usage
+fi
diff --git a/livesupport/modules/archiveServer/var/xmlrpc/xmlrpc.inc b/livesupport/modules/archiveServer/var/xmlrpc/xmlrpc.inc
new file mode 100644
index 000000000..b85365633
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/xmlrpc/xmlrpc.inc
@@ -0,0 +1,1489 @@
+
+// $Id: xmlrpc.inc,v 1.1 2004/09/21 00:43:32 tomas Exp $
+
+
+// Copyright (c) 1999,2000,2002 Edd Dumbill.
+// All rights reserved.
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions
+// are met:
+//
+//    * Redistributions of source code must retain the above copyright
+//      notice, this list of conditions and the following disclaimer.
+//
+//    * Redistributions in binary form must reproduce the above
+//      copyright notice, this list of conditions and the following
+//      disclaimer in the documentation and/or other materials provided
+//      with the distribution.
+//
+//    * Neither the name of the "XML-RPC for PHP" nor the names of its
+//      contributors may be used to endorse or promote products derived
+//      from this software without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
+// FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+// REGENTS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
+// INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+// (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+// SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION)
+// HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT,
+// STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+// ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+// OF THE POSSIBILITY OF SUCH DAMAGE.
+
+	if (!function_exists('xml_parser_create'))
+	{
+		// Win 32 fix. From: 'Leo West' 
+		if($WINDIR)
+		{
+			dl('php3_xml.dll');
+		}
+		else
+		{
+			dl('xml.so');
+		}
+	}
+
+	$xmlrpcI4='i4';
+	$xmlrpcInt='int';
+	$xmlrpcBoolean='boolean';
+	$xmlrpcDouble='double';
+	$xmlrpcString='string';
+	$xmlrpcDateTime='dateTime.iso8601';
+	$xmlrpcBase64='base64';
+	$xmlrpcArray='array';
+	$xmlrpcStruct='struct';
+
+	$xmlrpcTypes=array(
+		$xmlrpcI4       => 1,
+		$xmlrpcInt      => 1,
+		$xmlrpcBoolean  => 1,
+		$xmlrpcString   => 1,
+		$xmlrpcDouble   => 1,
+		$xmlrpcDateTime => 1,
+		$xmlrpcBase64   => 1,
+		$xmlrpcArray    => 2,
+		$xmlrpcStruct   => 3
+	);
+
+	$xmlEntities=array(
+		'amp'  => '&',
+		'quot' => '"',
+		'lt'   => '<',
+		'gt'   => '>',
+		'apos' => "'"
+	);
+
+	$xmlrpcerr['unknown_method']=1;
+	$xmlrpcstr['unknown_method']='Unknown method';
+	$xmlrpcerr['invalid_return']=2;
+	$xmlrpcstr['invalid_return']='Invalid return payload: enabling debugging to examine incoming payload';
+	$xmlrpcerr['incorrect_params']=3;
+	$xmlrpcstr['incorrect_params']='Incorrect parameters passed to method';
+	$xmlrpcerr['introspect_unknown']=4;
+	$xmlrpcstr['introspect_unknown']="Can't introspect: method unknown";
+	$xmlrpcerr['http_error']=5;
+	$xmlrpcstr['http_error']="Didn't receive 200 OK from remote server.";
+	$xmlrpcerr['no_data']=6;
+	$xmlrpcstr['no_data']='No data received from server.';
+	$xmlrpcerr['no_ssl']=7;
+	$xmlrpcstr['no_ssl']='No SSL support compiled in.';
+	$xmlrpcerr['curl_fail']=8;
+	$xmlrpcstr['curl_fail']='CURL error';
+
+
+	$xmlrpcerr["multicall_notstruct"] = 9;
+	$xmlrpcstr["multicall_notstruct"] = "system.multicall expected struct";
+	$xmlrpcerr["multicall_nomethod"]  = 10;
+	$xmlrpcstr["multicall_nomethod"]  = "missing methodName";
+	$xmlrpcerr["multicall_notstring"] = 11;
+	$xmlrpcstr["multicall_notstring"] = "methodName is not a string";
+	$xmlrpcerr["multicall_recursion"] = 12;
+	$xmlrpcstr["multicall_recursion"] = "recursive system.multicall forbidden";
+	$xmlrpcerr["multicall_noparams"]  = 13;
+	$xmlrpcstr["multicall_noparams"]  = "missing params";
+	$xmlrpcerr["multicall_notarray"]  = 14;
+	$xmlrpcstr["multicall_notarray"]  = "params is not an array";
+
+	$xmlrpc_defencoding='UTF-8';
+
+	$xmlrpcName='XML-RPC for PHP';
+	$xmlrpcVersion='1.0.99';
+
+	// let user errors start at 800
+	$xmlrpcerruser=800; 
+	// let XML parse errors start at 100
+	$xmlrpcerrxml=100;
+
+	// formulate backslashes for escaping regexp
+	$xmlrpc_backslash=chr(92).chr(92);
+
+	// used to store state during parsing
+	// quick explanation of components:
+	//   st - used to build up a string for evaluation
+	//   ac - used to accumulate values
+	//   qt - used to decide if quotes are needed for evaluation
+	//   cm - used to denote struct or array (comma needed)
+	//   isf - used to indicate a fault
+	//   lv - used to indicate "looking for a value": implements
+	//        the logic to allow values with no types to be strings
+	//   params - used to store parameters in method calls
+	//   method - used to store method name
+
+	$_xh=array();
+
+	function xmlrpc_entity_decode($string)
+	{
+		$top=split('&', $string);
+		$op='';
+		$i=0; 
+		while($i ";
+				break;
+			case 'BOOLEAN':
+				// special case here: we translate boolean 1 or 0 into PHP
+				// constants true or false
+				if ($_xh[$parser]['ac']=='1')
+				{
+					$_xh[$parser]['ac']='true';
+				}
+				else
+				{
+					$_xh[$parser]['ac']='false';
+					$_xh[$parser]['vt']=strtolower($name);
+					// Drop through intentionally.
+				}
+			case 'I4':
+			case 'INT':
+			case 'STRING':
+			case 'DOUBLE':
+			case 'DATETIME.ISO8601':
+			case 'BASE64':
+				if ($_xh[$parser]['qt']==1)
+				{
+					// we use double quotes rather than single so backslashification works OK
+					$_xh[$parser]['st'].='"'. $_xh[$parser]['ac'] . '"';
+				}
+				elseif ($_xh[$parser]['qt']==2)
+				{
+					$_xh[$parser]['st'].="base64_decode('". $_xh[$parser]['ac'] . "')"; 
+				}
+				elseif ($name=='BOOLEAN')
+				{
+					$_xh[$parser]['st'].=$_xh[$parser]['ac'];
+				}
+				else
+				{
+					// we have an I4, INT or a DOUBLE
+					// we must check that only 0123456789-. are characters here
+					if (!ereg("^\-?[0123456789 \t\.]+$", $_xh[$parser]['ac']))
+					{
+						// TODO: find a better way of throwing an error
+						// than this!
+						error_log('XML-RPC: non numeric value received in INT or DOUBLE');
+						$_xh[$parser]['st'].='ERROR_NON_NUMERIC_FOUND';
+					}
+					else
+					{
+						// it's ok, add it on
+						$_xh[$parser]['st'].=$_xh[$parser]['ac'];
+					}
+				}
+				$_xh[$parser]['ac']=''; $_xh[$parser]['qt']=0;
+				$_xh[$parser]['lv']=3; // indicate we've found a value
+				break;
+			case 'VALUE':
+				// deal with a string value
+				if (strlen($_xh[$parser]['ac'])>0 &&
+					$_xh[$parser]['vt']==$xmlrpcString)
+				{
+					$_xh[$parser]['st'].='"'. $_xh[$parser]['ac'] . '"'; 
+				}
+				// This if() detects if no scalar was inside 
+				// and pads an empty ''.
+				if($_xh[$parser]['st'][strlen($_xh[$parser]['st'])-1] == '(')
+				{
+					$_xh[$parser]['st'].= '""';
+				}
+				$_xh[$parser]['st'].=", '" . $_xh[$parser]['vt'] . "')";
+				if ($_xh[$parser]['cm'])
+				{
+					$_xh[$parser]['st'].=',';
+				}
+				break;
+			case 'MEMBER':
+				$_xh[$parser]['ac']=''; $_xh[$parser]['qt']=0;
+				break;
+			case 'DATA':
+				$_xh[$parser]['ac']=''; $_xh[$parser]['qt']=0;
+				break;
+			case 'PARAM':
+				$_xh[$parser]['params'][]=$_xh[$parser]['st'];
+				break;
+			case 'METHODNAME':
+				$_xh[$parser]['method']=ereg_replace("^[\n\r\t ]+", '', $_xh[$parser]['ac']);
+				break;
+			case 'BOOLEAN':
+				// special case here: we translate boolean 1 or 0 into PHP
+				// constants true or false
+				if ($_xh[$parser]['ac']=='1')
+				{
+					$_xh[$parser]['ac']='true';
+				}
+				else
+				{
+					$_xh[$parser]['ac']='false';
+					$_xh[$parser]['vt']=strtolower($name);
+				}
+				break;
+			default:
+				break;
+		}
+		// if it's a valid type name, set the type
+		if (isset($xmlrpcTypes[strtolower($name)]))
+		{
+			$_xh[$parser]['vt']=strtolower($name);
+		}
+	}
+
+	function xmlrpc_cd($parser, $data)
+	{
+		global $_xh, $xmlrpc_backslash;
+
+		//if (ereg("^[\n\r \t]+$", $data)) return;
+		// print "adding [${data}]\n";
+
+		if ($_xh[$parser]['lv']!=3)
+		{
+			// "lookforvalue==3" means that we've found an entire value
+			// and should discard any further character data
+			if ($_xh[$parser]['lv']==1)
+			{
+				// if we've found text and we're just in a  then
+				// turn quoting on, as this will be a string
+				$_xh[$parser]['qt']=1; 
+				// and say we've found a value
+				$_xh[$parser]['lv']=2; 
+			}
+			if(!@isset($_xh[$parser]['ac']))
+			{
+				$_xh[$parser]['ac'] = '';
+			}
+			$_xh[$parser]['ac'].=str_replace('$', '\$', str_replace('"', '\"', str_replace(chr(92),$xmlrpc_backslash, $data)));
+		}
+	}
+
+	function xmlrpc_dh($parser, $data)
+	{
+		global $_xh;
+		if (substr($data, 0, 1) == '&' && substr($data, -1, 1) == ';')
+		{
+			if ($_xh[$parser]['lv']==1)
+			{
+				$_xh[$parser]['qt']=1; 
+				$_xh[$parser]['lv']=2; 
+			}
+			$_xh[$parser]['ac'].=str_replace('$', '\$', str_replace('"', '\"', str_replace(chr(92),$xmlrpc_backslash, $data)));
+		}
+	}
+
+	class xmlrpc_client
+	{
+		var $path;
+		var $server;
+		var $port;
+		var $errno;
+		var $errstring;
+		var $debug=0;
+		var $username='';
+		var $password='';
+		var $cert='';
+		var $certpass='';
+		var $verifypeer=1;
+		var $verifyhost=1;
+		var $no_multicall=false;
+
+		function xmlrpc_client($path, $server, $port=0)
+		{
+			$this->port=$port; $this->server=$server; $this->path=$path;
+		}
+
+		function setDebug($in)
+		{
+			if ($in)
+			{
+				$this->debug=1;
+			}
+			else
+			{
+				$this->debug=0;
+			}
+		}
+
+		function setCredentials($u, $p)
+		{
+			$this->username=$u;
+			$this->password=$p;
+		}
+
+		function setCertificate($cert, $certpass)
+		{
+			$this->cert = $cert;
+			$this->certpass = $certpass;
+		}
+
+		function setSSLVerifyPeer($i)
+		{
+			$this->verifypeer = $i;
+		}
+
+		function setSSLVerifyHost($i)
+		{
+			$this->verifyhost = $i;
+		}
+
+		function send($msg, $timeout=0, $method='http')
+		{
+			if (is_array($msg))
+			{
+				// $msg is an array of xmlrpcmsg's
+				return $this->multicall($msg, $timeout, $method);
+			}
+
+			// where msg is an xmlrpcmsg
+			$msg->debug=$this->debug;
+
+			if ($method == 'https')
+			{
+				return $this->sendPayloadHTTPS($msg,
+				$this->server,
+				$this->port, $timeout,
+				$this->username, $this->password,
+				$this->cert,
+				$this->certpass);
+			}
+			else
+			{
+				return $this->sendPayloadHTTP10($msg, $this->server, $this->port,
+				$timeout, $this->username, 
+				$this->password);
+			}
+		}
+
+		function sendPayloadHTTP10($msg, $server, $port, $timeout=0,$username='', $password='')
+		{
+			global $xmlrpcerr, $xmlrpcstr;
+			if ($port==0)
+			{
+				$port=80;
+			}
+			if($timeout>0)
+			{
+				$fp=fsockopen($server, $port,$this->errno, $this->errstr, $timeout);
+			}
+			else
+			{
+				$fp=fsockopen($server, $port,$this->errno, $this->errstr);
+			}
+			if (!$fp)
+			{
+				$this->errstr='Connect error';
+				$r=new xmlrpcresp(0, $xmlrpcerr['http_error'],$xmlrpcstr['http_error']);
+				return $r;
+			}
+			// Only create the payload if it was not created previously
+			if(empty($msg->payload))
+			{
+				$msg->createPayload();
+			}
+
+			// thanks to Grant Rauscher 
+			// for this
+			$credentials='';
+			if ($username!='')
+			{
+				$credentials='Authorization: Basic ' . base64_encode($username . ':' . $password) . "\r\n";
+			}
+
+      //				"Host: ". $this->server . ":" . $this->port  . "\r\n" .
+
+			$op= "POST " . $this->path. " HTTP/1.0\r\nUser-Agent: PHP XMLRPC 1.0\r\n" .
+        "Host: ". $this->server  . "\r\n" .
+				$credentials . 
+				"Content-Type: text/xml\r\nContent-Length: " .
+				strlen($msg->payload) . "\r\n\r\n" .
+				$msg->payload;
+
+			if (!fputs($fp, $op, strlen($op)))
+			{
+				$this->errstr='Write error';
+				$r=new xmlrpcresp(0, $xmlrpcerr['http_error'], $xmlrpcstr['http_error']);
+				return $r;
+			}
+			$resp=$msg->parseResponseFile($fp);
+			fclose($fp);
+			return $resp;
+		}
+
+		// contributed by Justin Miller 
+		// requires curl to be built into PHP
+		function sendPayloadHTTPS($msg, $server, $port, $timeout=0,$username='', $password='', $cert='',$certpass='')
+		{
+			global $xmlrpcerr, $xmlrpcstr;
+			if ($port == 0)
+			{
+				$port = 443;
+			}
+
+			// Only create the payload if it was not created previously
+			if(empty($msg->payload))
+			{
+				$msg->createPayload();
+			}
+
+			if (!function_exists('curl_init'))
+			{
+				$this->errstr='SSL unavailable on this install';
+				$r=new xmlrpcresp(0, $xmlrpcerr['no_ssl'], $xmlrpcstr['no_ssl']);
+				return $r;
+			}
+
+			$curl = curl_init("https://" . $server . ':' . $port . $this->path);
+
+			curl_setopt($curl, CURLOPT_RETURNTRANSFER, 1);
+			// results into variable
+			if ($this->debug)
+			{
+				curl_setopt($curl, CURLOPT_VERBOSE, 1);
+			}
+			curl_setopt($curl, CURLOPT_USERAGENT, 'PHP XMLRPC 1.0');
+			// required for XMLRPC
+			curl_setopt($curl, CURLOPT_POST, 1);
+			// post the data
+			curl_setopt($curl, CURLOPT_POSTFIELDS, $msg->payload);
+			// the data
+			curl_setopt($curl, CURLOPT_HEADER, 1);
+			// return the header too
+			curl_setopt($curl, CURLOPT_HTTPHEADER, array('Content-Type: text/xml'));
+			// whether to verify remote host's cert
+			curl_setopt($curl, CURLOPT_SSL_VERIFYPEER, $this->verifypeer);
+			// whether to verify cert's common name (CN); 0 for no, 1 to verify that it exists, and 2 to verify that it matches the hostname used
+			curl_setopt($curl, CURLOPT_SSL_VERIFYHOST, $this->verifyhost);
+			// required for XMLRPC
+			if ($timeout)
+			{
+				curl_setopt($curl, CURLOPT_TIMEOUT, $timeout == 1 ? 1 : $timeout - 1);
+			}
+			// timeout is borked
+			if ($username && $password)
+			{
+				curl_setopt($curl, CURLOPT_USERPWD,"$username:$password");
+			}
+			// set auth stuff
+			if ($cert)
+			{
+				curl_setopt($curl, CURLOPT_SSLCERT, $cert);
+			}
+			// set cert file
+			if ($certpass)
+			{
+				curl_setopt($curl, CURLOPT_SSLCERTPASSWD,$certpass);
+			}
+			// set cert password
+
+			$result = curl_exec($curl);
+
+			if (!$result)
+			{
+				$this->errstr='no response';
+				$resp=new xmlrpcresp(0, $xmlrpcerr['curl_fail'], $xmlrpcstr['curl_fail']. ': '. curl_error($curl));
+			}
+			else
+			{
+				$resp = $msg->parseResponse($result);
+			}
+			curl_close($curl);
+			return $resp;
+		}
+
+		function multicall($msgs, $timeout=0, $method='http')
+		{
+			$results = false;
+
+			if (! $this->no_multicall)
+			{
+				$results = $this->_try_multicall($msgs, $timeout, $method);
+				/* TODO - this is not php3-friendly */
+				// if($results !== false)
+				if($results != false)
+				{
+					// Either the system.multicall succeeded, or the send
+					// failed (e.g. due to HTTP timeout).  In either case,
+					// we're done for now.
+					return $results;
+				}
+				else
+				{
+					// system.multicall unsupported by server,
+					// don't try it next time...
+					$this->no_multicall = true;
+				}
+			}
+
+			// system.multicall is unupported by server:
+			//   Emulate multicall via multiple requests
+			$results = array();
+			//foreach($msgs as $msg)
+			@reset($msgs);
+			while(list(,$msg) = @each($msgs))
+			{
+				$results[] = $this->send($msg, $timeout, $method);
+			}
+			return $results;
+		}
+
+		// Attempt to boxcar $msgs via system.multicall.
+		function _try_multicall($msgs, $timeout, $method)
+		{
+			// Construct multicall message
+			$calls = array();
+			//foreach($msgs as $msg)
+			@reset($msgs);
+			while(list(,$msg) = @each($msgs))
+			{
+				$call['methodName'] = new xmlrpcval($msg->method(),'string');
+				$numParams = $msg->getNumParams();
+				$params = array();
+				for ($i = 0; $i < $numParams; $i++)
+				{
+					$params[$i] = $msg->getParam($i);
+				}
+				$call['params'] = new xmlrpcval($params, 'array');
+				$calls[] = new xmlrpcval($call, 'struct');
+			}
+			$multicall = new xmlrpcmsg('system.multicall');
+			$multicall->addParam(new xmlrpcval($calls, 'array'));
+
+			// Attempt RPC call
+			$result = $this->send($multicall, $timeout, $method);
+			if (!is_object($result))
+				return ($result || 0); // transport failed
+
+			if ($result->faultCode() != 0)
+				return false;		// system.multicall failed
+
+			// Unpack responses.
+			$rets = $result->value();
+			if ($rets->kindOf() != 'array')
+				return false;		// bad return type from system.multicall
+			$numRets = $rets->arraysize();
+			if ($numRets != count($msgs))
+				return false;		// wrong number of return values.
+
+			$response = array();
+			for ($i = 0; $i < $numRets; $i++)
+			{
+				$val = $rets->arraymem($i);
+				switch ($val->kindOf())
+				{
+				case 'array':
+					if ($val->arraysize() != 1)
+						return false;		// Bad value
+					// Normal return value
+					$response[$i] = new xmlrpcresp($val->arraymem(0));
+					break;
+				case 'struct':
+					$code = $val->structmem('faultCode');
+					if ($code->kindOf() != 'scalar' || $code->scalartyp() != 'int')
+						return false;
+					$str = $val->structmem('faultString');
+					if ($str->kindOf() != 'scalar' || $str->scalartyp() != 'string')
+						return false;
+					$response[$i] = new xmlrpcresp(0, $code->scalarval(), $str->scalarval());
+					break;
+				default:
+					return false;
+				}
+			}
+			return $response;
+		}
+	} // end class xmlrpc_client
+
+	class xmlrpcresp
+	{
+		var $xv;
+		var $fn;
+		var $fs;
+		var $hdrs;
+
+		function xmlrpcresp($val, $fcode=0, $fstr='',$waserror=0)
+		{
+			//print "waserror=$waserror
";
+			if(($fcode != 0) || ($waserror != 0))
+			{
+				$this->xv = 0;
+				$this->fn = $fcode;
+				$this->fs = htmlspecialchars($fstr);
+			}
+			else
+			{
+				$this->xv = $val;
+				$this->fn = 0;
+			}
+		}
+
+		function faultCode()
+		{
+			if(isset($this->fn))
+			{
+				if($this->fn == 0) 
+				{
+					return -1;
+				}
+				else
+				{
+					return $this->fn;
+				}
+			}
+			else
+			{
+				return 0;
+			}
+		}
+
+		function faultString()
+		{
+			return $this->fs;
+		}
+
+		function value()
+		{
+			return $this->xv;
+		}
+
+		function serialize()
+		{
+			$rs="\n";
+			if ($this->fn)
+			{
+				$rs.='
+
+
+
+faultCode
+' . $this->fn . '
+
+
+faultString
+' . $this->fs . '
+
+
+
+';
+			}
+			else
+			{
+				$rs.="\n\n" . $this->xv->serialize() . 
+				"\n";
+			}
+			$rs.="\n";
+			return $rs;
+		}
+	}
+
+	class xmlrpcmsg
+	{
+		var $payload;
+		var $methodname;
+		var $params=array();
+		var $debug=0;
+
+		function xmlrpcmsg($meth, $pars=0)
+		{
+			$this->methodname=$meth;
+			if (is_array($pars) && sizeof($pars)>0)
+			{
+				for($i=0; $iaddParam($pars[$i]);
+				}
+			}
+		}
+
+		function xml_header()
+		{
+			return "\n\n";
+		}
+
+		function xml_footer()
+		{
+			return "\n";
+		}
+
+		function createPayload()
+		{
+			$this->payload=$this->xml_header();
+			$this->payload.="" . $this->methodname . "\n";
+			//	if (sizeof($this->params)) {
+			$this->payload.="\n";
+			for($i=0; $iparams); $i++)
+			{
+				$p=$this->params[$i];
+				$this->payload.="\n" . $p->serialize() .
+				"\n";
+			}
+			$this->payload.="\n";
+			// }
+			$this->payload.=$this->xml_footer();
+			$this->payload=str_replace("\n", "\r\n", $this->payload);
+		}
+
+		function method($meth='')
+		{
+			if ($meth!='')
+			{
+				$this->methodname=$meth;
+			}
+			return $this->methodname;
+		}
+
+		function serialize()
+		{
+			$this->createPayload();
+			return $this->payload;
+		}
+
+		function addParam($par) { $this->params[]=$par; }
+		function getParam($i) { return $this->params[$i]; }
+		function getNumParams() { return sizeof($this->params); }
+
+		function parseResponseFile($fp)
+		{
+			$ipd='';
+			while($data=fread($fp, 32768))
+			{
+				$ipd.=$data;
+			}
+			return $this->parseResponse($ipd);
+		}
+
+		function parseResponse($data='')
+		{
+			global $_xh,$xmlrpcerr,$xmlrpcstr;
+			global $xmlrpc_defencoding;
+
+			$parser = xml_parser_create($xmlrpc_defencoding);
+
+			$_xh[$parser]=array();
+
+			$_xh[$parser]['st']='';
+			$_xh[$parser]['cm']=0;
+			$_xh[$parser]['isf']=0;
+			$_xh[$parser]['ac']='';
+			$_xh[$parser]['qt']='';
+			$_xh[$parser]['ha']='';
+
+			xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true);
+			xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee');
+			xml_set_character_data_handler($parser, 'xmlrpc_cd');
+			xml_set_default_handler($parser, 'xmlrpc_dh');
+			$xmlrpc_value=new xmlrpcval;
+
+			$hdrfnd = 0;
+			if($this->debug)
+			{
+				//by maHo, replaced htmlspecialchars with htmlentities
+				print "
---GOT---\n" . htmlentities($data) . "\n---END---\n
";
+			}
+			if($data == '')
+			{
+				error_log('No response received from server.');
+				$r = new xmlrpcresp(0, $xmlrpcerr['no_data'], $xmlrpcstr['no_data']);
+				xml_parser_free($parser);
+				return $r;
+			}
+			// see if we got an HTTP 200 OK, else bomb
+			// but only do this if we're using the HTTP protocol.
+			if(ereg("^HTTP",$data) && !ereg("^HTTP/[0-9\.]+ 200 ", $data))
+			{
+				$errstr= substr($data, 0, strpos($data, "\n")-1);
+				error_log('HTTP error, got response: ' .$errstr);
+				$r=new xmlrpcresp(0, $xmlrpcerr['http_error'], $xmlrpcstr['http_error']. ' (' . $errstr . ')');
+				xml_parser_free($parser);
+				return $r;
+			}
+
+			// if using HTTP, then gotta get rid of HTTP headers here
+			// and we store them in the 'ha' bit of our data array
+			if (ereg("^HTTP", $data))
+			{
+				$ar=explode("\r\n", $data);
+				$newdata='';
+				$hdrfnd=0;
+				for ($i=0; $i0)
+						{
+							$_xh[$parser]['ha'].=$ar[$i]. "\r\n";
+						}
+						else
+						{
+							$hdrfnd=1;
+						}
+					}
+					else
+					{
+						$newdata.=$ar[$i] . "\r\n";
+					}
+				}
+				$data=$newdata;
+			}
+
+			if ($this->debug)
+			{
+				@reset($_xh[$parser]['ha']);
+				while (list($x,$header) = @each($_xh[$parser]['ha']))
+				{
+					echo "HEADER: $header\n";
+				}
+			}
+			// end Patch
+			if (!xml_parse($parser, $data, sizeof($data)))
+			{
+				// thanks to Peter Kocks 
+				if((xml_get_current_line_number($parser)) == 1)
+				{
+					$errstr = 'XML error at line 1, check URL';
+				}
+				else
+				{
+					$errstr = sprintf('XML error: %s at line %d',
+						xml_error_string(xml_get_error_code($parser)),
+						xml_get_current_line_number($parser));
+						error_log($errstr);
+						$r=new xmlrpcresp(0, $xmlrpcerr['invalid_return'], $xmlrpcstr['invalid_return']);
+					xml_parser_free($parser);
+					echo $errstr;
+					return $r;
+				}
+			}
+			xml_parser_free($parser);
+			if ($this->debug)
+			{
+				print "
---EVALING---[" . 
+				strlen($_xh[$parser]['st']) . " chars]---\n" . 
+				htmlspecialchars($_xh[$parser]['st']) . ";\n---END---
";
+			}
+			if (strlen($_xh[$parser]['st'])==0)
+			{
+				// then something odd has happened
+				// and it's time to generate a client side error
+				// indicating something odd went on
+				$r=new xmlrpcresp(0, $xmlrpcerr["invalid_return"],
+				$xmlrpcstr["invalid_return"]);
+			}
+			else
+			{
+				eval('$v=' . $_xh[$parser]['st'] . '; $allOK=1;');
+				if ($_xh[$parser]['isf'])
+				{
+					$f=$v->structmem('faultCode');
+					$fs=$v->structmem('faultString');
+
+					$r = new xmlrpcresp($v, $f->scalarval(),
+						$fs->scalarval(),1 /* even if errornum=0, indicate that there is error. modified by maHo */
+					);
+
+				}
+				else
+				{
+					$r=new xmlrpcresp($v);
+				}
+			}
+			$r->hdrs = @split("\r?\n", $_xh[$parser]['ha'][1]);
+			return $r;
+		}
+	}
+
+	class xmlrpcval
+	{
+		var $me=array();
+		var $mytype=0;
+
+		function xmlrpcval($val=-1, $type='')
+		{
+			global $xmlrpcTypes;
+			$this->me=array();
+			$this->mytype=0;
+			if ($val!=-1 || $type!='')
+			{
+				if ($type=='')
+				{
+					$type='string';
+				}
+				if ($xmlrpcTypes[$type]==1)
+				{
+					$this->addScalar($val,$type);
+				}
+				elseif ($xmlrpcTypes[$type]==2)
+				{
+					$this->addArray($val);
+				}
+				elseif ($xmlrpcTypes[$type]==3)
+				{
+					$this->addStruct($val);
+				}
+			}
+		}
+
+		function addScalar($val, $type='string')
+		{
+			global $xmlrpcTypes, $xmlrpcBoolean;
+
+			if ($this->mytype==1)
+			{
+				echo 'xmlrpcval: scalar can have only one value
';
+				return 0;
+			}
+			$typeof=$xmlrpcTypes[$type];
+			if ($typeof!=1)
+			{
+				echo 'xmlrpcval: not a scalar type (${typeof})
';
+				return 0;
+			}
+
+			if ($type==$xmlrpcBoolean)
+			{
+				if (strcasecmp($val,'true')==0 || $val==1 || ($val==true && strcasecmp($val,'false')))
+				{
+					$val=1;
+				}
+				else
+				{
+					$val=0;
+				}
+			}
+
+			if ($this->mytype==2)
+			{
+				// we're adding to an array here
+				$ar=$this->me['array'];
+				$ar[]=new xmlrpcval($val, $type);
+				$this->me['array']=$ar;
+			}
+			else
+			{
+				// a scalar, so set the value and remember we're scalar
+				$this->me[$type]=$val;
+				$this->mytype=$typeof;
+			}
+			return 1;
+		}
+
+		function addArray($vals)
+		{
+			global $xmlrpcTypes;
+			if ($this->mytype!=0)
+			{
+				echo 'xmlrpcval: already initialized as a [' . $this->kindOf() . ']
';
+				return 0;
+			}
+
+			$this->mytype=$xmlrpcTypes['array'];
+			$this->me['array']=$vals;
+			return 1;
+		}
+
+		function addStruct($vals)
+		{
+			global $xmlrpcTypes;
+			if ($this->mytype!=0)
+			{
+				echo 'xmlrpcval: already initialized as a [' . $this->kindOf() . ']
';
+				return 0;
+			}
+			$this->mytype=$xmlrpcTypes['struct'];
+			$this->me['struct']=$vals;
+			return 1;
+		}
+
+		function dump($ar)
+		{
+			reset($ar);
+			while ( list( $key, $val ) = each( $ar ) )
+			{
+				echo "$key => $val
";
+				if ($key == 'array')
+				{
+					while ( list( $key2, $val2 ) = each( $val ) )
+					{
+						echo "-- $key2 => $val2
";
+					}
+				}
+			}
+		}
+
+		function kindOf()
+		{
+			switch($this->mytype)
+			{
+				case 3:
+					return 'struct';
+					break;
+				case 2:
+					return 'array';
+					break;
+				case 1:
+					return 'scalar';
+					break;
+				default:
+					return 'undef';
+			}
+		}
+
+		function serializedata($typ, $val)
+		{
+			$rs='';
+			global $xmlrpcTypes, $xmlrpcBase64, $xmlrpcString,
+			$xmlrpcBoolean;
+			switch($xmlrpcTypes[$typ])
+			{
+				case 3:
+					// struct
+					$rs.="\n";
+					reset($val);
+					while(list($key2, $val2)=each($val))
+					{
+						$rs.="${key2}\n";
+						$rs.=$this->serializeval($val2);
+						$rs.="\n";
+					}
+					$rs.='';
+					break;
+				case 2:
+					// array
+					$rs.="\n\n";
+					for($i=0; $iserializeval($val[$i]);
+					}
+					$rs.="\n";
+					break;
+				case 1:
+					switch ($typ)
+					{
+						case $xmlrpcBase64:
+							$rs.="<${typ}>" . base64_encode($val) . "";
+							break;
+						case $xmlrpcBoolean:
+							$rs.="<${typ}>" . ($val ? "1" : "0") . "";
+							break;
+						case $xmlrpcString:
+              $rs.="<${typ}>" . rawurlencode($val). "";  // micsik
+							//$rs.="<${typ}>" . htmlspecialchars($val). "";
+							break;
+						default:
+							$rs.="<${typ}>${val}";
+					}
+					break;
+				default:
+					break;
+			}
+			return $rs;
+		}
+
+		function serialize()
+		{
+			return $this->serializeval($this);
+		}
+
+		function serializeval($o)
+		{
+			global $xmlrpcTypes;
+			$rs='';
+			$ar=$o->me;
+			reset($ar);
+			list($typ, $val) = each($ar);
+			$rs.='';
+			$rs.=$this->serializedata($typ, $val);
+			$rs.="\n";
+			return $rs;
+		}
+
+		function structmem($m)
+		{
+			$nv=$this->me['struct'][$m];
+			return $nv;
+		}
+
+		function structreset()
+		{
+			reset($this->me['struct']);
+		}
+
+		function structeach()
+		{
+			return each($this->me['struct']);
+		}
+
+		function getval()
+		{
+			// UNSTABLE
+			global $xmlrpcBoolean, $xmlrpcBase64;
+			reset($this->me);
+			list($a,$b)=each($this->me);
+			// contributed by I Sofer, 2001-03-24
+			// add support for nested arrays to scalarval
+			// i've created a new method here, so as to
+			// preserve back compatibility
+
+			if (is_array($b))
+			{
+				@reset($b);
+				while(list($id,$cont) = @each($b))
+				{
+					$b[$id] = $cont->scalarval();
+				}
+			}
+
+			// add support for structures directly encoding php objects
+			if (is_object($b))
+			{
+				$t = get_object_vars($b);
+				@reset($t);
+				while(list($id,$cont) = @each($t))
+				{
+					$t[$id] = $cont->scalarval();
+				}
+				@reset($t);
+				while(list($id,$cont) = @each($t))
+				{
+					eval('$b->'.$id.' = $cont;');
+				}
+			}
+			// end contrib
+			return $b;
+		}
+
+		function scalarval()
+		{
+			global $xmlrpcBoolean, $xmlrpcBase64;
+			reset($this->me);
+			list($a,$b)=each($this->me);
+			return rawurldecode($b);  // micsik
+		}
+
+		function scalartyp()
+		{
+			global $xmlrpcI4, $xmlrpcInt;
+			reset($this->me);
+			list($a,$b)=each($this->me);
+			if ($a==$xmlrpcI4)
+			{
+				$a=$xmlrpcInt;
+			}
+			return $a;
+		}
+
+		function arraymem($m)
+		{
+			$nv=$this->me['array'][$m];
+			return $nv;
+		}
+
+		function arraysize()
+		{
+			reset($this->me);
+			list($a,$b)=each($this->me);
+			return sizeof($b);
+		}
+	}
+
+	// date helpers
+	function iso8601_encode($timet, $utc=0)
+	{
+		// return an ISO8601 encoded string
+		// really, timezones ought to be supported
+		// but the XML-RPC spec says:
+		//
+		// "Don't assume a timezone. It should be specified by the server in its
+		// documentation what assumptions it makes about timezones."
+		// 
+		// these routines always assume localtime unless 
+		// $utc is set to 1, in which case UTC is assumed
+		// and an adjustment for locale is made when encoding
+		if (!$utc)
+		{
+			$t=strftime("%Y%m%dT%H:%M:%S", $timet);
+		}
+		else
+		{
+			if (function_exists('gmstrftime'))
+			{
+				// gmstrftime doesn't exist in some versions
+				// of PHP
+				$t=gmstrftime("%Y%m%dT%H:%M:%S", $timet);
+			}
+			else
+			{
+				$t=strftime("%Y%m%dT%H:%M:%S", $timet-date('Z'));
+			}
+		}
+		return $t;
+	}
+
+	function iso8601_decode($idate, $utc=0)
+	{
+		// return a timet in the localtime, or UTC
+		$t=0;
+		if (ereg("([0-9]{4})([0-9]{2})([0-9]{2})T([0-9]{2}):([0-9]{2}):([0-9]{2})", $idate, $regs))
+		{
+			if ($utc)
+			{
+				$t=gmmktime($regs[4], $regs[5], $regs[6], $regs[2], $regs[3], $regs[1]);
+			}
+			else
+			{
+				$t=mktime($regs[4], $regs[5], $regs[6], $regs[2], $regs[3], $regs[1]);
+			}
+		} 
+		return $t;
+	}
+
+	/****************************************************************
+	* xmlrpc_decode takes a message in PHP xmlrpc object format and *
+	* tranlates it into native PHP types.                           *
+	*                                                               *
+	* author: Dan Libby (dan@libby.com)                             *
+	****************************************************************/
+	function xmlrpc_decoder($xmlrpc_val)
+	{
+		$kind = $xmlrpc_val->kindOf();
+
+		if($kind == 'scalar')
+		{
+			return $xmlrpc_val->scalarval();
+		}
+		elseif($kind == 'array')
+		{
+			$size = $xmlrpc_val->arraysize();
+			$arr = array();
+
+			for($i = 0; $i < $size; $i++)
+			{
+				$arr[]=xmlrpc_decoder($xmlrpc_val->arraymem($i));
+			}
+			return $arr; 
+		}
+		elseif($kind == 'struct')
+		{
+			$xmlrpc_val->structreset();
+			$arr = array();
+
+			while(list($key,$value)=$xmlrpc_val->structeach())
+			{
+				$arr[$key] = xmlrpc_decoder($value);
+			}
+			return $arr;
+		}
+	}
+
+	/****************************************************************
+	* xmlrpc_encode takes native php types and encodes them into    *
+	* xmlrpc PHP object format.                                     *
+	* BUG: All sequential arrays are turned into structs.  I don't  *
+	* know of a good way to determine if an array is sequential     *
+	* only.                                                         *
+	*                                                               *
+	* feature creep -- could support more types via optional type   *
+	* argument.                                                     *
+	*                                                               *
+	* author: Dan Libby (dan@libby.com)                             *
+	****************************************************************/
+	function xmlrpc_encoder($php_val)
+	{
+		global $xmlrpcInt;
+		global $xmlrpcDouble;
+		global $xmlrpcString;
+		global $xmlrpcArray;
+		global $xmlrpcStruct;
+		global $xmlrpcBoolean;
+
+		$type = gettype($php_val);
+		$xmlrpc_val = new xmlrpcval;
+
+		switch($type)
+		{
+			case 'array':
+			case 'object':
+				$arr = array();
+				while (list($k,$v) = each($php_val))
+				{
+					$arr[$k] = xmlrpc_encoder($v);
+				}
+				$xmlrpc_val->addStruct($arr);
+				break;
+			case 'integer':
+				$xmlrpc_val->addScalar($php_val, $xmlrpcInt);
+				break;
+			case 'double':
+				$xmlrpc_val->addScalar($php_val, $xmlrpcDouble);
+				break;
+			case 'string':
+				$xmlrpc_val->addScalar($php_val, $xmlrpcString);
+				break;
+				// 
+				// Add support for encoding/decoding of booleans, since they are supported in PHP
+			case 'boolean':
+				$xmlrpc_val->addScalar($php_val, $xmlrpcBoolean);
+				break;
+				// 
+			case 'unknown type':
+			default:
+				// giancarlo pinerolo 
+				// it has to return 
+				// an empty object in case (which is already
+				// at this point), not a boolean. 
+				break;
+		}
+		return $xmlrpc_val;
+	}
+?>
diff --git a/livesupport/modules/archiveServer/var/xmlrpc/xmlrpcs.inc b/livesupport/modules/archiveServer/var/xmlrpc/xmlrpcs.inc
new file mode 100644
index 000000000..daffa2ae2
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/xmlrpc/xmlrpcs.inc
@@ -0,0 +1,450 @@
+
+// $Id: xmlrpcs.inc,v 1.1 2004/09/21 00:43:34 tomas Exp $
+
+// Copyright (c) 1999,2000,2002 Edd Dumbill.
+// All rights reserved.
+//
+// Redistribution and use in source and binary forms, with or without
+// modification, are permitted provided that the following conditions
+// are met:
+//
+//    * Redistributions of source code must retain the above copyright
+//      notice, this list of conditions and the following disclaimer.
+//
+//    * Redistributions in binary form must reproduce the above
+//      copyright notice, this list of conditions and the following
+//      disclaimer in the documentation and/or other materials provided
+//      with the distribution.
+//
+//    * Neither the name of the "XML-RPC for PHP" nor the names of its
+//      contributors may be used to endorse or promote products derived
+//      from this software without specific prior written permission.
+//
+// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
+// FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+// REGENTS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
+// INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+// (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+// SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION)
+// HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT,
+// STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+// ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+// OF THE POSSIBILITY OF SUCH DAMAGE.
+
+	// XML RPC Server class
+	// requires: xmlrpc.inc
+
+	// listMethods: either a string, or nothing
+	$_xmlrpcs_listMethods_sig=array(array($xmlrpcArray, $xmlrpcString), array($xmlrpcArray));
+	$_xmlrpcs_listMethods_doc='This method lists all the methods that the XML-RPC server knows how to dispatch';
+	function _xmlrpcs_listMethods($server, $m)
+	{
+		global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
+		$v=new xmlrpcval();
+		$dmap=$server->dmap;
+		$outAr=array();
+		for(reset($dmap); list($key, $val)=each($dmap); )
+		{
+			$outAr[]=new xmlrpcval($key, 'string');
+		}
+		$dmap=$_xmlrpcs_dmap;
+		for(reset($dmap); list($key, $val)=each($dmap); )
+		{
+			$outAr[]=new xmlrpcval($key, 'string');
+		}
+		$v->addArray($outAr);
+		return new xmlrpcresp($v);
+	}
+
+	$_xmlrpcs_methodSignature_sig=array(array($xmlrpcArray, $xmlrpcString));
+	$_xmlrpcs_methodSignature_doc='Returns an array of known signatures (an array of arrays) for the method name passed. If no signatures are known, returns a none-array (test for type != array to detect missing signature)';
+	function _xmlrpcs_methodSignature($server, $m)
+	{
+		global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
+
+		$methName=$m->getParam(0);
+		$methName=$methName->scalarval();
+		if (ereg("^system\.", $methName))
+		{
+			$dmap=$_xmlrpcs_dmap; $sysCall=1;
+		}
+		else
+		{
+			$dmap=$server->dmap; $sysCall=0;
+		}
+		//	print "\n";
+		if (isset($dmap[$methName]))
+		{
+			if ($dmap[$methName]['signature'])
+			{
+				$sigs=array();
+				$thesigs=$dmap[$methName]['signature'];
+				for($i=0; $igetParam(0);
+		$methName=$methName->scalarval();
+		if (ereg("^system\.", $methName))
+		{
+			$dmap=$_xmlrpcs_dmap; $sysCall=1;
+		}
+		else
+		{
+			$dmap=$server->dmap; $sysCall=0;
+		}
+		//	print "\n";
+		if (isset($dmap[$methName]))
+		{
+			if ($dmap[$methName]['docstring'])
+			{
+				$r=new xmlrpcresp(new xmlrpcval($dmap[$methName]["docstring"]), 'string');
+			}
+			else
+			{
+				$r=new xmlrpcresp(new xmlrpcval('', 'string'));
+			}
+		}
+		else
+		{
+			$r=new xmlrpcresp(0, $xmlrpcerr['introspect_unknown'], $xmlrpcstr['introspect_unknown']);
+		}
+		return $r;
+	}
+
+	$_xmlrpcs_multicall_sig = array(array($xmlrpcArray, $xmlrpcArray));
+	$_xmlrpcs_multicall_doc = 'Boxcar multiple RPC calls in one request. See http://www.xmlrpc.com/discuss/msgReader$1208 for details';
+
+	function _xmlrpcs_multicall_error($err)
+	{
+		if (is_string($err))
+		{
+			global $xmlrpcerr, $xmlrpcstr;
+			$str  = $xmlrpcstr["multicall_${err}"];
+			$code = $xmlrpcerr["multicall_${err}"];
+		}
+		else
+		{
+			$code = $err->faultCode();
+			$str = $err->faultString();
+		}
+		$struct['faultCode'] = new xmlrpcval($code, 'int');
+		$struct['faultString'] = new xmlrpcval($str, 'string');
+		return new xmlrpcval($struct, 'struct');
+	}
+
+	function _xmlrpcs_multicall_do_call($server, $call)
+	{
+    	if ($call->kindOf() != 'struct')
+            return _xmlrpcs_multicall_error('notstruct');
+        $methName = $call->structmem('methodName');
+		if (!$methName)
+    		return _xmlrpcs_multicall_error('nomethod');
+  		if ($methName->kindOf() != 'scalar' || $methName->scalartyp() != 'string')
+    		return _xmlrpcs_multicall_error('notstring');
+  		if ($methName->scalarval() == 'system.multicall')
+    		return _xmlrpcs_multicall_error('recursion');
+
+  		$params = $call->structmem('params');
+  		if (!$params)
+    		return _xmlrpcs_multicall_error('noparams');
+  		if ($params->kindOf() != 'array')
+    		return _xmlrpcs_multicall_error('notarray');
+  		$numParams = $params->arraysize();
+  
+  		$msg = new xmlrpcmsg($methName->scalarval());
+  		for ($i = 0; $i < $numParams; $i++)
+    		$msg->addParam($params->arraymem($i));
+
+  		$result = $server->execute($msg);
+  
+  		if ($result->faultCode() != 0)
+    		return _xmlrpcs_multicall_error($result);    // Method returned fault.
+
+  		return new xmlrpcval(array($result->value()), "array");
+	}
+  
+	function _xmlrpcs_multicall($server, $m)
+	{
+  		$calls = $m->getParam(0);
+        $numCalls = $calls->arraysize();
+        $result = array();
+
+        for ($i = 0; $i < $numCalls; $i++)
+        {
+			$call = $calls->arraymem($i);
+			$result[$i] = _xmlrpcs_multicall_do_call($server, $call);
+		}
+
+        return new xmlrpcresp(new xmlrpcval($result, 'array'));
+    }
+
+	$_xmlrpcs_dmap=array(
+		'system.listMethods' => array(
+			'function' => '_xmlrpcs_listMethods',
+			'signature' => $_xmlrpcs_listMethods_sig,
+			'docstring' => $_xmlrpcs_listMethods_doc),
+		'system.methodHelp' => array(
+			'function' => '_xmlrpcs_methodHelp',
+			'signature' => $_xmlrpcs_methodHelp_sig,
+			'docstring' => $_xmlrpcs_methodHelp_doc),
+		'system.methodSignature' => array(
+			'function' => '_xmlrpcs_methodSignature',
+			'signature' => $_xmlrpcs_methodSignature_sig,
+			'docstring' => $_xmlrpcs_methodSignature_doc),
+		'system.multicall' => array(
+			'function' => '_xmlrpcs_multicall',
+			'signature' => $_xmlrpcs_multicall_sig,
+			'docstring' => $_xmlrpcs_multicall_doc
+		)
+	);
+
+	$_xmlrpc_debuginfo='';
+	function xmlrpc_debugmsg($m)
+	{
+		global $_xmlrpc_debuginfo;
+		$_xmlrpc_debuginfo=$_xmlrpc_debuginfo . $m . "\n";
+	}
+
+	class xmlrpc_server
+	{
+		var $dmap=array();
+
+		function xmlrpc_server($dispMap='', $serviceNow=1)
+		{
+			global $HTTP_RAW_POST_DATA;
+			// dispMap is a dispatch array of methods
+			// mapped to function names and signatures
+			// if a method
+			// doesn't appear in the map then an unknown
+			// method error is generated
+			/* milosch - changed to make passing dispMap optional.
+			 * instead, you can use the class add_to_map() function
+			 * to add functions manually (borrowed from SOAPX4)
+			 */
+			if($dispMap)
+			{
+				$this->dmap = $dispMap;
+				if($serviceNow)
+				{
+					$this->service();
+				}
+			}
+		}
+
+		function serializeDebug()
+		{
+			global $_xmlrpc_debuginfo;
+			if ($_xmlrpc_debuginfo!='')
+			{
+				return "\n";
+			}
+			else
+			{
+				return '';
+			}
+		}
+
+		function service()
+		{
+			global $xmlrpc_defencoding;
+
+			$r=$this->parseRequest();
+			$payload='' . "\n"
+				. $this->serializeDebug()
+				. $r->serialize();
+			Header("Content-type: text/xml\r\nContent-length: " . 
+			strlen($payload));
+			print $payload;
+		}
+
+		/*
+		add a method to the dispatch map
+		*/
+		function add_to_map($methodname,$function,$sig,$doc)
+		{
+			$this->dmap[$methodname] = array(
+				'function'  => $function,
+				'signature' => $sig,
+				'docstring' => $doc
+			);
+		}
+
+		function verifySignature($in, $sig)
+		{
+			for($i=0; $igetNumParams()+1)
+				{
+					$itsOK=1;
+					for($n=0; $n<$in->getNumParams(); $n++)
+					{
+						$p=$in->getParam($n);
+						// print "\n";
+						if ($p->kindOf() == 'scalar')
+						{
+							$pt=$p->scalartyp();
+						}
+						else
+						{
+							$pt=$p->kindOf();
+						}
+						// $n+1 as first type of sig is return type
+						if ($pt != $cursig[$n+1])
+						{
+							$itsOK=0;
+							$pno=$n+1; $wanted=$cursig[$n+1]; $got=$pt;
+							break;
+						}
+					}
+					if ($itsOK)
+					{
+						return array(1);
+					}
+				}
+			}
+			return array(0, "Wanted ${wanted}, got ${got} at param ${pno})");
+		}
+
+		function parseRequest($data='')
+		{
+			global $_xh,$HTTP_RAW_POST_DATA;
+			global $xmlrpcerr, $xmlrpcstr, $xmlrpcerrxml, $xmlrpc_defencoding,
+			$_xmlrpcs_dmap;
+
+			if ($data=="")
+			{
+				$data=$HTTP_RAW_POST_DATA;
+			}
+			$parser = xml_parser_create($xmlrpc_defencoding);
+
+			$_xh[$parser]=array();
+			$_xh[$parser]['st']='';
+			$_xh[$parser]['cm']=0;
+			$_xh[$parser]['isf']=0;
+			$_xh[$parser]['params']=array();
+			$_xh[$parser]['method']='';
+
+			// decompose incoming XML into request structure
+
+			xml_parser_set_option($parser, XML_OPTION_CASE_FOLDING, true);
+			xml_set_element_handler($parser, 'xmlrpc_se', 'xmlrpc_ee');
+			xml_set_character_data_handler($parser, 'xmlrpc_cd');
+			xml_set_default_handler($parser, 'xmlrpc_dh');
+			if (!xml_parse($parser, $data, 1))
+			{
+				// return XML error as a faultCode
+				$r=new xmlrpcresp(0,
+				$xmlrpcerrxml+xml_get_error_code($parser),
+				sprintf("XML error: %s at line %d",
+					xml_error_string(xml_get_error_code($parser)),
+					xml_get_current_line_number($parser)));
+				xml_parser_free($parser);
+			}
+			else
+			{
+				xml_parser_free($parser);
+				$m=new xmlrpcmsg($_xh[$parser]['method']);
+				// now add parameters in
+				$plist="";
+				for($i=0; $i\n";
+					$plist.="$i - " .  $_xh[$parser]['params'][$i]. " \n";
+					eval('$m->addParam(' . $_xh[$parser]['params'][$i]. ");");
+				}
+				// uncomment this to really see what the server's getting!
+				// xmlrpc_debugmsg($plist);
+
+				$r = $this->execute($m);
+			}
+			return $r;
+		}
+
+		function execute ($m)
+		{
+			global $xmlrpcerr, $xmlrpcstr, $_xmlrpcs_dmap;
+			// now to deal with the method
+			$methName = $m->method();
+			$sysCall = ereg("^system\.", $methName);
+			$dmap = $sysCall ? $_xmlrpcs_dmap : $this->dmap;
+
+			if (!isset($dmap[$methName]['function']))
+			{
+				// No such method
+				return new xmlrpcresp(0,
+					$xmlrpcerr['unknown_method'],
+					$xmlrpcstr['unknown_method']);
+			}
+
+			// Check signature.
+			if (isset($dmap[$methName]['signature']))
+			{
+				$sig = $dmap[$methName]['signature'];
+				list ($ok, $errstr) = $this->verifySignature($m, $sig);
+				if (!$ok)
+				{
+					// Didn't match.
+					return new xmlrpcresp(0,
+						$xmlrpcerr['incorrect_params'],
+						$xmlrpcstr['incorrect_params'] . ": ${errstr}");
+				}
+			}
+
+			$func = $dmap[$methName]['function'];
+
+			if ($sysCall)
+			{
+				return call_user_func($func, $this, $m);
+			}
+			else
+			{
+				return call_user_func($func, $m);
+			}
+		}
+
+		function echoInput()
+		{
+			global $HTTP_RAW_POST_DATA;
+
+			// a debugging routine: just echos back the input
+			// packet as a string value
+
+			$r=new xmlrpcresp;
+			$r->xv=new xmlrpcval( "'Aha said I: '" . $HTTP_RAW_POST_DATA, 'string');
+			print $r->serialize();
+		}
+	}
+?>
diff --git a/livesupport/modules/archiveServer/var/xmlrpc/xrArchive.php b/livesupport/modules/archiveServer/var/xmlrpc/xrArchive.php
new file mode 100644
index 000000000..7c2b941d9
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/xmlrpc/xrArchive.php
@@ -0,0 +1,252 @@
+setFetchMode(DB_FETCHMODE_ASSOC);
+
+/**
+ *  XMLRPC layer for Archive module
+ */
+class XR_Archive extends Archive{
+    /**
+     *  Simple ping method - return strtouppered string
+     */
+    function xr_ping($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        return new xmlrpcresp(new xmlrpcval(strtoupper($r['par']), "string"));
+    }
+
+    /**
+     *  Open download
+     */
+    function xr_downloadOpen($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->downloadOpen($r['sessid'], $r['gunid']);
+        if(PEAR::isError($res))
+            return new xmlrpcresp(0, 803,
+                "xr_downloadOpen: ".$res->getMessage().
+                " ".$res->getUserInfo()
+            );
+        return new xmlrpcresp(xmlrpc_encoder($res));
+    }
+
+    /**
+     *  Close download
+     */
+    function xr_downloadClose($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->downloadClose($r['sessid'], $r['url']);
+        if(PEAR::isError($res))
+            return new xmlrpcresp(0, 803,
+                "xr_downloadOpen: ".$res->getMessage().
+                " ".$res->getUserInfo()
+            );
+        return new xmlrpcresp(xmlrpc_encoder($res));
+    }
+
+    /**
+     *  Open upload
+     */
+    function xr_uploadOpen($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->uploadOpen($r['sessid'], $r['gunid']);
+        if(PEAR::isError($res))
+            return new xmlrpcresp(0, 803,
+                "xr_downloadOpen: ".$res->getMessage().
+                " ".$res->getUserInfo()
+            );
+        return new xmlrpcresp(xmlrpc_encoder($res));
+    }
+
+    /**
+     *  Abort upload
+     */
+    function xr_uploadAbort($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->uploadAbort($r['sessid'], $r['url']);
+        if(PEAR::isError($res))
+            return new xmlrpcresp(0, 803,
+                "xr_downloadOpen: ".$res->getMessage().
+                " ".$res->getUserInfo()
+            );
+        return new xmlrpcresp(xmlrpc_encoder($res));
+    }
+
+    /**
+     *  Check upload
+     */
+    function xr_uploadCheck($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->uploadCheck($r['sessid'], $r['url']);
+        if(PEAR::isError($res))
+            return new xmlrpcresp(0, 803,
+                "xr_downloadOpen: ".$res->getMessage().
+                " ".$res->getUserInfo()
+            );
+        return new xmlrpcresp(xmlrpc_encoder($res));
+    }
+
+    /**
+     *  Close upload
+     */
+    function xr_uploadClose($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->uploadClose($r['sessid'], $r['url']);
+        if(PEAR::isError($res))
+            return new xmlrpcresp(0, 803,
+                "xr_downloadOpen: ".$res->getMessage().
+                " ".$res->getUserInfo()
+            );
+        return new xmlrpcresp(xmlrpc_encoder($res));
+    }
+
+
+    /**
+     *  Call Archive::login
+     *
+     *  @param input XMLRPC struct
+     */
+    function xr_login($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        if(!($res = $this->login($r['login'], $r['pass'])))
+            return new xmlrpcresp(0, 802,
+                "xr_login: login failed - incorrect username or password ({$r['login']}/{$r['pass']})."
+            );
+        else
+            return new xmlrpcresp($this->_v2xr($res, false));
+    }
+
+    /**
+     *  Call Archive::logout
+     *
+     *  @param input XMLRPC struct
+     */
+    function xr_logout($input)
+    {
+        list($ok, $r) = $this->_xr_getPars($input);
+        if(!$ok) return $r;
+        $res = $this->logout($r['sessid']);
+        if(!PEAR::isError($res))
+            return new xmlrpcresp($this->_v2xr('Bye', false));
+        else
+            return new xmlrpcresp(0, 803,
+                "xr_logout: logout failed - not logged."
+            );
+    }
+
+    /**
+     *  Convert PHP variables to XMLRPC objects
+     *
+     *  @param var mixed - PHP variable
+     *  @param struct boolean - flag for using XMLRPC struct instead of array
+     *  @return XMLRPC object
+     */
+    function _v2xr($var, $struct=true){
+        if(is_array($var)){
+            $r = array();
+            foreach($var as $k=>$v){
+                if($struct) $r[$k]=$this->_v2xr($v);
+                else $r[]=$this->_v2xr($v);
+            }
+            return new xmlrpcval($r, ($struct ? "struct" : "array"));
+        }else if(is_int($var)){
+            return new xmlrpcval($var, "int");
+        }else if(is_bool($var)){
+            return new xmlrpcval($var, "boolean");
+        }else{
+            return new xmlrpcval($var, "string");
+        }
+    }
+
+    /**
+     *  Convert XMLRPC struct to PHP array
+     *
+     *  @param input XMLRPC struct
+     */
+    function _xr_getPars($input)
+    {
+        $p = $input->getParam(0);
+        if(isset($p) && $p->scalartyp()=="struct"){
+            $p->structreset();  $r = array();
+            while(list($k,$v) = $p->structeach()){ $r[$k] = $v->scalarval(); }
+            return array(TRUE, $r);
+        }
+        else return array(FALSE, new xmlrpcresp(0, 801,
+            "xr_login: wrong 1st parameter, struct expected."
+        ));
+    }
+}
+
+$archive = &new XR_Archive(&$dbc, $config);
+
+$methods = array(
+    'login'                   => 'Login to storage.',
+    'logout'                  => 'Logout from storage.',
+    'ping'              =>'Echo request',
+    'downloadOpen'      =>'Open download channel',
+    'downloadClose'     =>'Close download channel',
+    'uploadOpen'        =>'Open upload channel',
+    'uploadAbort'       =>'Close upload channel',
+    'uploadCheck'       =>'Check size and checksum of uploaded file',
+    'uploadClose'       =>'Close upload channel'
+);
+
+$defs = array();
+foreach($methods as $method=>$description){
+    $defs["archive.$method"] = array(
+            "function" => array(&$archive, "xr_$method"),
+            "signature" => array(array($xmlrpcStruct, $xmlrpcStruct)),
+            "docstring" => $description
+    );
+}
+$s=new xmlrpc_server( $defs );
+?>
\ No newline at end of file
diff --git a/livesupport/modules/archiveServer/var/xmlrpc/xr_cli_test.py b/livesupport/modules/archiveServer/var/xmlrpc/xr_cli_test.py
new file mode 100755
index 000000000..0353fdfed
--- /dev/null
+++ b/livesupport/modules/archiveServer/var/xmlrpc/xr_cli_test.py
@@ -0,0 +1,89 @@
+#!/usr/bin/python
+
+#------------------------------------------------------------------------------
+#
+#    Copyright (c) 2004 Media Development Loan Fund
+# 
+#    This file is part of the LiveSupport project.
+#    http://livesupport.campware.org/
+#    To report bugs, send an e-mail to bugs@campware.org
+# 
+#    LiveSupport is free software; you can redistribute it and/or modify
+#    it under the terms of the GNU General Public License as published by
+#    the Free Software Foundation; either version 2 of the License, or
+#    (at your option) any later version.
+#  
+#    LiveSupport is distributed in the hope that it will be useful,
+#    but WITHOUT ANY WARRANTY; without even the implied warranty of
+#    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#    GNU General Public License for more details.
+# 
+#    You should have received a copy of the GNU General Public License
+#    along with LiveSupport; if not, write to the Free Software
+#    Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
+# 
+# 
+#    Author   : $Author: tomas $
+#    Version  : $Revision: 1.1 $
+#    Location : $Source: /home/paul/cvs2svn-livesupport/newcvsrepo/livesupport/modules/archiveServer/var/xmlrpc/Attic/xr_cli_test.py,v $
+#
+#------------------------------------------------------------------------------
+
+from xmlrpclib import *
+import sys
+
+if len(sys.argv)<3:
+    print """
+ Usage: xr_cli_pok.py [-v] [-s http:////xmlrpc/xrGreenBox.php]  
+   commands and args:
+     listMethods
+     methodHelp 
+     methodSignature 
+     ping 
+     login  
+     logout 
+"""
+    sys.exit(1)
+
+pars = sys.argv
+verbose=0
+if pars[1]=="-v":
+    pars.pop(1)
+    verbose=1
+if pars[1]=="-s":
+    pars.pop(1)
+    serverPath = pars.pop(1)
+else:
+    serverPath = 'http://localhost:80/storage/xmlrpc/xrLocStor.php'
+server = Server(serverPath)
+method = pars.pop(1)
+pars.pop(0)
+if verbose:
+    print "method: "+method
+    print "pars: "
+    print pars
+    print "result:"
+#sys.exit(0)
+
+try:
+    if method=="listMethods":
+        print server.system.listMethods()
+    elif method=="methodHelp":
+        print server.system.methodHelp(pars[0])
+    elif method=="methodSignature":
+        print server.system.methodSignature(pars[0])
+    elif method=="ping":
+        print server.archive.ping({'par':pars[0]})
+    elif method=="login":
+        print server.archive.login({'login':pars[0], 'pass':pars[1]})
+    elif method=="logout":
+        print server.archive.logout({'sessid':pars[0]})
+    elif method=="downloadOpen":
+        print server.archive.downloadOpen({'sessid':pars[0], 'gunid':pars[1]})
+    elif method=="downloadClose":
+        print server.archive.downloadClose({'sessid':pars[0], 'url':pars[1]})
+    else:
+        print "Unknown command: "+method
+        sys.exit(1)
+except Error, v:
+    print "XML-RPC Error:",v